
  • Số trang: 38 |
  • Loại file: DOC |
  • Lượt xem: 41 |
  • Lượt tải: 0

Đã đăng 588 tài liệu

Mô tả:

Tuyeån taäp ñeà thi hoïc sinh gioûi Quoác Gia Trang:0 ********************************************************************************************************************************* SỞ GIÁO DỤC ĐÀO TẠO LÂM ĐỒNG Trường THPT Chuyên Thăng Long – Đà Lạt TUYỂN TẬP ĐỀ THI HỌC SINH GIỎI QUỐC GIA MÔ HÓA HỌC Biên Soạn: Thầy Nguyễn Thành Anh Tổ trưởng bộ môn Hóa Học Đà Lạt – Tháng 5/2005 Bé Gi¸o Dôc Vµ §µo T¹o  §Ò Thi Quèc Gia Chän HS Giái THPT M«n Thi: Ho¸ Häc Líp 12 - B¶ng A Ngµy thi: 2/3/1994 (180 phót, kh«ng kÓ thêi gian giao ®Ò ) Tuyeån taäp ñeà thi hoïc sinh gioûi Quoác Gia Trang:1 ********************************************************************************************************************************* - - - - - o0o - - - - C©u 1: 1. Nªu ph¬ng ph¸p ho¸ häc cã thÓ dïng ®Ó lo¹i c¸c chÊt ®éc sau: a. SO2, NO2, HF trong khÝ th¶i c«ng nghiÖp. b. Lîng lín clo trong phßng thÝ nghiÖm. c. Pb2+ hoÆc Cu2+ trong níc th¶i c¸c nhµ m¸y. ViÕt ®Çy ®ñ c¸c ph¬ng tr×nh ph¶n øng x¶y ra. 2. Tõ 0,1 mol H2SO4 cã thÓ ®iÒu chÕ 1,12 lÝt; 2,24 lÝt; 3,36 lÝt SO 2 ®îc kh«ng? Gi¶i thÝch t¹i sao ®îc hay kh«ng ®îc. NÕu ®îc, minh ho¹ b»ng c¸c vÝ dô cô thÓ. Tr×nh bµy ph¬ng ph¸p thu SO2 tinh khiÕt ®iÒu chÕ ë trªn. C©u 2: 1. Lµm c¸c thÝ nghiÖm sau: o ThÝ nghiÖm 1: Cho vµo dung dÞch H2SO4 lo·ng ®ùng trong 3 cèc ®¸nh sè 1, 2, 3 mçi cèc mét miÕng s¾t. o ThÝ nghiÖm 2: Thªm vµo cèc 1 miÕng nh«m ®Æt tiÕp xóc víi miÕng s¾t. o ThÝ nghiÖm 3: Thªm vµ cèc 2 mét miÕng ®ång ®Æt tiÕp xóc víi miÕng s¾t. o ThÝ nghiÖm 4: Thªm vµo cèc 3 mét miÕng b¹c ®Æt tiÕp xóc víi miÕng s¾t. Tr×nh bµy vµ so s¸nh c¸c hiÖn tîng x¶y ra trong c¸c thÝ nghiÖm trªn. ViÕt ph¬ng tr×nh vÒ c¸c hiÖn tîng ®ã. Gi¶i thÝch sù kh¸c nhau vÒ c¸c hiÖn tîng x¶y ra trong c¸c thÝ nghiÖm. 2. a. H·y viÕt s¬ ®å vµ ph¬ng tr×nh x¶y ra khi ®iÖn ph©n dung dÞch CuSO 4 víi hai ®iÖn cùc b»ng Platin. b. Sau khi ®iÖn ph©n ®îc mét thêi gian, ng¾t nguån ®iÖn ngoµi vµ nèi hai ®iÖn cùc trªn b»ng d©y dÉn, cã hiÖn tîng g× x¶y ra? Gi¶i thÝch vµ minh ho¹ b»ng ph¬ng ph¸p ho¸ häc. C©u 3: 1. a. Nªu ý nghÜa vÒ cÊu t¹o cña cÊu h×nh electron 1s22s22p63s23p6. b. CÊu h×nh nµy cã thÓ gÆp ë lo¹i chÊt nµo? Minh ho¹ b»ng tÝnh chÊt cô thÓ. c. Nªu tÝnh chÊt cña chÊt trong thÝ dô trªn. 2. Dùa vµo ®é ©m ®iÖn cña nguyªn tè trong b¶ng sau: O Na Mg Al Si P S Cl Nguyeân toá §é ©m ®iÖn 3,5 0,9 1,2 1,5 1,8 2,1 2,5 3,0 a. Nªu b¶n chÊt liªn kÕt ho¸ häc trong oxit cña mçi nguyªn tè ë møc oxi ho¸ cao nhÊt. b. Ph©n lo¹i c¸c oxit trªn. ViÕt ph¬ng tr×nh ph¶n øng nªu râ tÝnh chÊt ho¸ häc cña mçi lo¹i oxit. 3. Tr×nh bµy cã gi¶i thÝch nh÷ng yÕu tè quan trong nhÊt lµm t¨ng tèc ®é ë giai ®o¹n oxi ho¸ SO 2 thµnh SO3 trong qu¸ tr×nh s¶n xuÊt H2SO4. Caâu 4: 1. KhuÊy a gam mét chÊt trong b cm 3 chÊt láng cã khèi lîng riªng D1 ®Ó t¹o thµnh mét dung dÞch cã khèi lîng riªng D2. a. ThiÕt lËp c«ng thøc dïng ®Ó tÝnh nång ®é % theo khèi lîng vµ nång ®é mol/lit cña dung dÞch trªn. b. Nªu nh÷ng ®iÒu kiÖn ®Ó cã thÓ ¸p dông ®îc c«ng thøc thiÕt lËp ra. Caâu 5: Bµi to¸n Hçn hîp A gåm hai oxit s¾t. DÉn tõ tõ khÝ hidr« ®i qua m gam A ®ùng trong èng sø ®· nung nãng ®Õn nhiÖt ®é thÝch hîp. S¶n phÈm t¹o nªn lµ 2,07 gam níc vµ 8,48 gam hçn hìp B gåm hai chÊt r¾n. Hoµ tan B trong 200 ml dung dÞch H 2SO4 1M thu ®îc mét dung dÞch D vµ 1971,2 ml H 2 ®kc ë 27,30C vµ 1atm. Cho D t¸c dông víi dung dÞch NaOH d sÏ ®îc kÕt tña E. Cho E tiÕp xóc víi kh«ng khÝ ®Ó chuyÓn E hoµn toµn thµnh chÊt r¾n F. Khèi lîng cña E vµ F kh¸c nhau 1,36 gam. 1. TÝnh m. 2. T×m nång ®é cña hîp chÊt vµ ion trong dung dÞch D, cho r»ng thÓ tÝch dung dÞch D thay ®æi kh«ng ®¸ng kÓ so víi thÓ tÝch dung dÞch H2SO4 ®· dïng. 3. Thµnh lËp c«ng thøc vµ tÝnh thµnh phÇn % theo khèi lîng cña mçi chÊt trong A. -----o o----- Cho H = 1, O = 16, Fe = 56 Häc sinh ®îc sö dông b¶ng HTTH c¸c nguyªn tè ho¸ häc. Tuyeån taäp ñeà thi hoïc sinh gioûi Quoác Gia Trang:2 ********************************************************************************************************************************* Bé Gi¸o Dôc Vµ §µo T¹o  B¶ng A: B¶ng B: A. C©u hái lý thuyÕt. §Ò Thi Quèc Gia Chän HS Giái THPT M«n Thi: Ho¸ Häc Líp 12 Ngµy thi: 2/3/1995 (180 phót, kh«ng kÓ thêi gian giao ®Ò ) Lµm tÊt c¶ c¸c C©u hái lý thuyÕt vµ Bµi to¸n. Bá 2, trong C©u II: 2, trong C©u III: 4, trong Bµi to¸n. - - - - - o0o - - - - - C©u I: 1. Trong phßng thÝ nghiÖm cã dd NaOH (dung m«i lµ níc). a/ H·y tr×nh bµy nguyªn t¾c ®Ó x¸c ®Þnh nång ®é mol/lit cña dd NaOH ®· cho. b/ H·y tù cho c¸c sè liÖu cô thÓ vµ tÝnh nång ®é mol/lit cña dd NaOH ®ã. 2. Cã 3 lä ®îc ®¸nh sè, mçi lä cã chøa mét trong c¸c dd sau: natri sunfat, canxi axetat, nh«m sunfat, natri hi®roxit, bari clorua. ChÊt nµo ®îc chøa trong lä sè mÊy, nÕu: o Rãt dd tõ lä 4 vµo lä 3, cã kÕt tña tr¾ng. o Rãt dd tõ lä 2 vµo lä 1, cã kÕt tña keo, tiÕp tôc rãt thªm kÕt tña ®ã bÞ tan. o Rãt dd tõ lä 4 vµo lä 5, ban ®Çu cha cã kÕt tña, rãt thªm th× cã lîng nhá kÕt tña xuÊt hiÖn. Trong mçi trêng hîp gi¶i thÝch ®Òu cã viÕt ph¬ng tr×nh ph¶n øng. 3. H·y ®Ò nghÞ c¸ch t¸ch lÊy tõng muèi trong hçn hîp r¾n gåm : clorua cña amoni, bari, magie (cã viÕt ®Çy ®ñ ph¬ng tr×nh ph¶n øng). C©u II: 1. Thùc nghiÖm cho biÕt: sau 0,75 gi©y th× 30ml KOH 1M trung hoµ võa hÕt 30ml H 2SO4 0,5M . H·y x¸c ®Þnh tèc ®é cña ph¶n øng ®ã theo lîng KOH: theo läng H2SO4. KÕt qu¶ thu ®îc ë mçi trêng hîp ®ã cã hîp lÝ kh«ng? T¹i sao? 2. H·y ®a ra c¸c biÓu thøc cÇn thiÕt ®Ó chøng minh vai trß cña hÖ sè c¸c chÊt trong ph¬ng tr×nh ph¶n øng khi x¸c ®Þnh tèc ®é ph¶n øng. (dïng ph¬ng tr×nh aA + bB  d D + eE víi gi¶ thiÕt ph¬ng tr×nh ®ã ®ñ ®¬n gi¶n ®Ó dïng trong trêng hîp nµy). C©u III: 1. CÇn 2 lÝt dd CuSO4 0,01M cã pH = 2.00 ®Ó m¹ ®iÖn: a. T¹i sao dd cÇn pH thÊp nh vËy. b. Trong phßng thÝ nghiÖm cã muèi CuSO4.5H2O, níc nguyªn chÊt, H2SO4 98% (D = 1,84 g/ml). H·y tr×nh bµy c¸ch chuÈn bÞ dung dÞch trªn (bá qua chÊt phô). 2. Cã vËt cÇn m¹, b¶n ®ång, dd võa ®îc chuÈn bÞ trªn vµ nguån ®iÖn thÝch hîp: a. H·y tr×nh bµy s¬ ®å cña hÖ thèng ®Ó thùc hiÖn sù m¹ ®iÖn nµy (cã vÏ h×nh). ViÕt ph¬ng tr×nh ph¶n øng x¶y ra trªn ®iÖn cùc. b. TÝnh thêi gian thùc hiÖn sù m¹ ®iÖn nÕu biÕt: I = 0,5 Ampe; líp m¹ cã ®iÖn tÝch 10 cm 2, bÒ dµy 0,17 mm; khèi lîng riªng cña ®ång lµ 8,89 g/cm3; hiÖu suÊt sù ®iÖn ph©n nµy ®¹t 80%. C©u IV: H·y viÕt ph¬ng tr×nh ph¶n øng ho¸ häc x¶y ra ë mçi trêng hîp sau ®©y: 1. §iÒu chÕ H2SO4 theo ph¬ng ph¸p nitro : oxi ho¸ SO2 b»ng NO2 trong dd níc (cã th¨ng b»ng electron). 2. §iÒu chÕ mét chÊt trong thµnh phÇn cña nhiªn liÖu tªn löa b»ng c¸ch cho khÝ F 2 ®i chËm qua muèi r¾n KNO3 hoÆc KClO4 (trong mçi trêng hîp ®Òu t¹o ra 2 s¶n phÈm, trong ®ã lu«n cã KF). 3. FeS hoÆc FeCO3 bÞ oxi ho¸ b»ng oxi trong kh«ng khÝ Èm t¹o thµnh Fe(OH)3 (cã th¨ng b»ng electron). 4. Fe2O3, Fe2S3, Fe(OH)3 bÞ hoµ tan trong dd axit m¹nh (d) ®Òu t¹o ra ion [Fe(H2O)6]3+ B. Bµi to¸n: Hçn hîp A gåm bét Al vµ S. Cho 13,275 gam A t¸c dông víi 400 ml HCl 2M thu ®îc 8,316 lÝt khÝ H2 t¹i 27,3oC vµ 1 atm; trong b×nh sau ph¶n øng cã dd B. NÕu nung nãng 6,6375 gam A trong b×nh kÝn kh«ng cã oxi tíi nhiÖt ®é thÝch hîp, ®îc chÊt D. Hoµ tan D trong 200 ml HCl 2M ®îc khÝ E vµ dd F. 1. H·y tÝnh nång ®é c¸c chÊt vµ c¸c ion trong dd B, dd F. 2. TÝnh pH cña mçi dd ®ã vµ nªu râ nguyªn nh©n ph¶i t¹o pH thÊp nh vËy. Tuyeån taäp ñeà thi hoïc sinh gioûi Quoác Gia Trang:3 ********************************************************************************************************************************* 3. DÉn khÝ E (®· ®îc lµm kh«) qua èng sø chøa 31,5 gam bét CuO nung nãng tíi nhiÖt ®é thÝch hîp (kh«ng cã oxi cña kh«ng khÝ). Ph¶n øng xong ta thu ®îc nh÷ng chÊt nµo? TÝnh lîng mçi chÊt ®ã. (BiÕt trong s¶n phÈm : chÊt r¾n lµ nguyªn chÊt, tÝnh theo gam ; chÊt khÝ hay h¬i ®o t¹i 100oC, 1atm; khi tÝnh sè mol ®îc lÊy tíi ch÷ sè thø 5 sau dÊu phÈy). 4. Rãt tõ tõ (cã khuÊy ®Òu) cho ®Õn hÕt 198 ml NaOH 10% (D = 1,10 g/ml) vµo dd F: a. H·y nªu vµ gi¶i thÝch hiÖn tîng x¶y ra. b. TÝnh lîng kÕt tña thu ®îc (nhiÒu nhÊt; Ýt nhÊt). -----o o----Cho Cu = 64; S = 32; Al = 27; O = 16; H = 1. Ghi chó: ThÝ sinh ®îc dïng lo¹i m¸y tÝnh c¸ nh©n bá tói, b¶ng sè logarit Bé Gi¸o Dôc Vµ §µo T¹o  §Ò Thi Quèc Gia Chän HäC SINH Giái THPT M«n Thi: Ho¸ Häc Líp 12 Ngµy thi: 3/3/1995 (180 phót, kh«ng kÓ thêi gian giao ®Ò ) B¶ng A: Lµm tÊt c¶ c¸c C©u hái lý thuyÕt vµ Bµi to¸n B¶ng B: Bá 2. trong C©u IV: 2. trong Bµi to¸n A. C©u hái lý thuyÕt: C©u I: 1. H·y s¾p xÕp c¸c hîp chÊt trong d·y sau ®©y theo thø tù t¨ng dÇn møc ®é linh ®éng cña nguyªn tö H trong nhãm chøc (cã vÝ dô vÒ ph¶n øng kÌm theo): axit axetic, rîu etylic, phenol, níc. 2. §é ©m ®iÖn cña C trong C2H6, C2H4, C2H2 t¬ng øng b»ng 2,48; 2,75; 3,29. H·y s¾p xÕp ba chÊt trªn theo thø tù gi¶m dÇn ®é ph©n cùc cña liªn kÕt C-H; lÊy vÝ dô ph¶n øng ho¸ häc ®Ó minh ho¹ vµ dïng c¸c sè liÖu trªn ®Ó gi¶i thÝch sù s¾p xÕp ®ã. C©u II: 1. H·y gäi tªn (CH3)2CH-CH =CH-C(CH3)3 (CH 3) 2 CH CH CH C(CH3 ) 3 CH2 2. Nh÷ng hi®rocacbon nµy cã ®ång ph©n cis-trans hay kh«ng? ViÕt c«ng thøc c¸c ®ång ph©n ®ã (nÕu cã). §iÒu kiÖn vÒ cÊu t¹o ®Ó cho mét hîp chÊt h÷u c¬ cã ®ång ph©n cis-trans lµ g×? Axit elai®ic lµ ®ång ph©n cña axit oleic. Khi oxi ho¸ m¹nh axit elai®ic b»ng KMnO 4 trong H2SO4 ®Ó c¾t nhãm - CH = CH - thµnh hai nhãm - COOH, thu ®îc hai axit cacboxylic cã m¹ch kh«ng ph©n nh¸nh lµ C9H18O2 (A) vµ C9H16O4 (B) ViÕt c«ng thøc cÊu t¹o cña A vµ B, tõ ®ã suy ra c«ng thøc cÊu t¹o cña axit elai®ic. ViÕt ph ¬ng tr×nh ph¶n øng oxi ho¸ ë trªn. Axit elai®ic vµ axit oleic lµ nh÷ng chÊt ®ång ph©n lo¹i g×? C©u III: 1. Polime cao su thiªn nhiªn vµ polime lÊy tõ nhùa c©y gut-ta-pec-cha ®Òu cã c«ng thøc (C 5H8)n: lo¹i thø nhÊt cã cÊu tróc cis, lo¹i thø hai cã cÊu tróc trans. ViÕt c«ng thøc cÊu t¹o mét ®o¹n m¹ch polime cho mçi lo¹i. 2. Cho HCl t¸c dông víi cao su thiªn nhiªn sinh ra cao su hi®roclo chøa 20,6% Cl trong ph©n tö. ViÕt ph¬ng tr×nh ph¶n øng ®ã vµ cho biÕt trong ph©n tö cao su hi®rocio cã cßn cÊu tróc cis hay kh«ng? Gi¶i thÝch. C©u IV: Tõ mét loµi thùc vËt ngêi ta t¸ch ®îc chÊt A (C10H12O2). A ph¶n øng víi dd NaOH t¹o thµnh chÊt B (C10H11O2Na). B ph¶n øng víi CH3I cho chÊt C (C10H11O(OCH3)) vµ NaI. H¬i cña C ph¶n øng víi H 2 nhê chÊt xóc t¸c Ni cho chÊt D (C10H13O(OCH3)). D ph¶n øng víi dd KMnO4 trong H2SO4 t¹o thµnh axit 3,4®imetoxibenzoic cã c«ng thøc 3,4-(CH3O)2C6H2COOH vµ axit axetic. 1. ViÕt c«ng thøc cÊu t¹o cña A, B, C: biÕt r»ng A, B, C kh«ng cã ®ång ph©n cis-trans, c¸c c«ng thøc trong ngoÆc ®¬n ë trªn vµ c«ng thøc ph©n tö. 2. ViÕt ph¬ng tr×nh c¸c ph¶n øng x¶y ra. Tuyeån taäp ñeà thi hoïc sinh gioûi Quoác Gia Trang:4 ********************************************************************************************************************************* B.Bµi to¸n: Hai hîp chÊt h÷u c¬ A, B cã cïng c«ng thøc ph©n tö vµ ®Òu chøa C, H, Br, khi ®un nãng víi dd NaOH lo·ng chÊt A t¹o ra chÊt C cã chøa mét nhãm chøc. ChÊt B kh«ng t¸c dông víi dd NaOH nh ®iÒu kiÖn ë trªn. 5,4 gam chÊt C ph¶n øng hoµn toµn víi Na cho 0,616 lÝt H 2 ë 27,3oC vµ 1atm. §èt ch¸y hoµn toµn 1,35 gam chÊt C thu ®îc 3,85 gam CO2. Khi cho A hoÆc B ph¶n øng víi Br 2 (cã mÆt bét Fe) ®Òu thÊy khi HBr tho¸t ra: sau ph¶n øng A t¹o ra 3 chÊt D, E, F cßn B t¹o ra 2 chÊt G, H. 1. ViÕt c«ng thøc cÊu t¹o cña A, B, C vµ c¸c c«ng thøc cÊu t¹o cã thÓ cã cña D, E, F, G, H. BiÕt r»ng ph©n tö cña D, E, F, G, H ®Òu chøa 64% Br. 2. Cho hçn hîp gåm 171gam chÊt A vµ 78 gam benzen ph¶n øng víi Br 2 cã mÆt bét Fe. Sau ph¶n øng thu ®îc 125,6 gam br«m benzen, 90 gam chÊt D, 40 gam chÊt E vµ 30 gam chÊt F. H·y cho biÕt chÊt A ph¶n øng víi Br2 khã (hoÆc dÔ) h¬n benzen bao nhiªu lÇn? -----o o----- Cho Br = 80; O = 16; H = 1. Bé Gi¸o Dôc Vµ §µo T¹o  §Ò Thi Quèc Gia Chän HäC SINH Giái THPT M«n Thi: Ho¸ Häc Líp 12 Ngµy thi: 2/3/1996 (180 phót, kh«ng kÓ thêi gian giao ®Ò ) C©u I: 1. a) H·y chØ ra ®iÓm sai ë mçi cÊu h×nh e- sau: (1) 1s22s12p5 (2) 1s22s22p53s23p64s23d6 (3) 1s22s22p64p64s2 b) ViÕt l¹i cho ®óng mçi cÊu h×nh trªn. Mçi cÊu h×nh ®óng ®ã lµ cÊu h×nh cña h¹t nµo? H·y viÕt mét ph¬ng tr×nh ph¶n øng chøng minh tÝnh chÊt ho¸ häc ®iÓn h×nh ( nÕu cã ) cña h¹t ®ã? 2. Ba nguyªn tè X, Y, Z trong cïng mét chu kú cã tæng sè hiÖu nguyªn tö lµ 39. Sè hiÖu cña nguyªn tö Y b»ng trung b×nh céng sè hiÖu cña nguyªn tö X vµ Z. Nguyªn tö cña 3 nguyªn tè nµy hÇu nh kh«ng ph¶n øng víi H2O ë ®iÒu kiÖn thêng. a) H·y x¸c ®Þnh vÞ trÝ c¸c nguyªn tè ®ã trong b¶ng tuÇn hoµn c¸c nguyªn tè ho¸ häc. ViÕt cÊu h×nh e cña nguyªn tö vµ gäi tªn tõng nguyªn tè. b) So s¸nh ®é ©m ®iÖn, b¸n kÝnh nguyªn tö cña c¸c nguyªn tè ®ã. c) So s¸nh tÝnh baz¬ cña c¸c hi®roxit. d) T×m c¸ch t¸ch tõng oxit ra khái hçn hîp oxit cña 3 nguyªn tè ®ã. C©u II: 1.Khi hoµ tan SO2 vµo H2O, cã c¸c c©n b»ng sau: SO2 + H2O �� (1) ��� � H2SO3 + H2SO3 �� (2) ��� � H + HSO3 + 2HSO3 �� (3) ��� �H + SO3 Nång ®é cña SO2 ë c©n b¨ng thay ®æi ra sao (cã gi¶i thÝch) ë mçi trêng hîp sau: a/ ®un nãng dd. b/ Thªm HCl c/ Thªm NaOH d/ Thªm KMnO4 2. §Ó x¸c ®Þnh nhiÖt sinh cña NO b»ng ph¬ng ph¸p nhiÖt lîng kÕ, ngêi ta lµm hai thÝ nghiÖm sau: ThÝ nghiÖm 1: ®èt phèt pho trong luång khÝ NO, sau 12’ thu ®îc 1,508 gam H3PO4. ThÝ nghiÖm 2: ®èt phèt pho trong hçn hîp ®ång thÓ tÝch N2, O2. Sau 10’ thu ®îc 2,123 gam H3PO4 a) H·y viÕt ph¬ng tr×nh ph¶n øng x¶y ra (trong b×nh nhiÖt lîng kÕ cã H2O) b) TÝnh tèc ®é trung b×nh cña qu¸ tr×nh t¹o ra H 3PO4 ë mçi thÝ nghiÖm trªn. T¹i sao cã sù kh¸c nhau vÒ trÞ sè ®ã? 3. B»ng c¸ch nµo lo¹i bá mçi khÝ trong hçn hîp khÝ sau: a) SO2 trong hçn hîp SO2 vµ CO2 b) SO3 trong hçn hîp SO3 vµ SO2 c) CO2 trong hçn hîp H2 vµ CO2 d) HCl trong hçn hîp HCl vµ CO2 C©u III: 1.Tõ thùc nghiÖm ngêi ta x¸c ®Þnh ®îc: khi ph¶n øng Tuyeån taäp ñeà thi hoïc sinh gioûi Quoác Gia Trang:5 ********************************************************************************************************************************* NH4HS (r¾n) �� ��� � NH3(khÝ) + H2S(khÝ) (1) ®¹t tíi c©n b»ng th× tÝch sè PNH3. PH2S = 0,109 (trÞ sè nµy lµ h»ng sè ë nhiÖt ®é 25oC) a) H·y x¸c ®Þnh ¸p suÊt chung cña khÝ t¸c dông lªn hÖ (1) nÕu ban ®Çu b×nh ch©n kh«ng vµ chØ ®a vµo ®ã NH4HS r¾n. b) NÕu ban ®Çu ®a vµo b×nh ®ã (ch©n kh«ng) mét lîng NH4HS r¾n vµ khÝ NH3, khi ®¹t tíi c©n b»ng ho¸ häc th× cã PNH3 = 0,0549 atm. H·y tÝnh ¸p suÊt khÝ NH3 trong b×nh tríc khi ph¶n øng (1) x¶y ra t¹i 25oC 2.Mét trong nh÷ng ph¬ng ph¸p ®iÒu chÕ Al2O3 trong c«ng nghiÖp tr¶i qua mét sè giai ®o¹n chÝnh sau ®©y: - Nung Nefelin (NaKAl2Si2O8) víi CaCO3 trong lß ë 1200oC - Ng©m níc s¶n phÈm t¹o thµnh ®îc dd muèi aluminat. Na[Al(OH)4(H2O)2]; K[Al(OH)4(H2O)2] vµ bïn quÆng CaSiO3 - ChiÕt lÊy dd, sôc CO2 d qua dd ®ã. - Nung kÕt tña Al(OH)3 ®îc Al2O3. H·y viÕt c¸c ph¬ng tr×nh ph¶n øng x¶y ra. C©u IV: 1. Ph¶n øng nµo x¶y ra khi lµm b·o hoµ dd Na2CO3 (bá qua sù thuû ph©n) b»ng: a/ KhÝ Cl2 b/ KhÝ NO2 2. Cã c¸c cÆp: Cr2O72-/2Cr3+; Fe3+/Fe2+; Cl2/2Cl-; MnO4-/Mn2+ H·y hoµn thµnh ph¬ng tr×nh ph¶n øng sau (nÕu cã) a) K2Cr2O7 + HCl  ? b) Cl2 + FeCl2  ? c) FeCl3 + HCl  ? d) Cl2 + MnSO4  ? e) KMnO4 + FeCl3  ? f) KMnO4 + HCl  ? (BiÕt tÝnh oxi ho¸ gi¶m dÇn theo thø tù: MnO4- > Cr2O72-  Cl2 > Fe3+) 3. Cã c¸c ion sau: Ba2+; Ag+; H+(H3O+); Cl-; NO3-; SO42-. a) H·y cho biÕt c«ng thøc chÊt tan hoÆc chÊt Ýt tan t¹o thµnh. b) Trong 5 dd, mçi dd chØ chøa mét trong c¸c chÊt ë phÇn (a). NÕu kh«ng dïng thªm chÊt kh¸c, b»ng c¸ch nµo cã thÓ nhËn ra chÊt trong mçi dd (cã gi¶i thÝch). Bé Gi¸o Dôc Vµ §µo T¹o §Ò Thi Quèc Gia Chän HäC SINH Giái THPT M«n Thi: Ho¸ Häc Líp 12 Ngµy thi: 3/3/1996 (180 phót, kh«ng kÓ thêi gian giao ®Ò ) C©u I: Khi clo ho¸ C5H12 ë 100oC cã chiÕu s¸ng thu ®îc c¸c s¶n phÈm víi tØ lÖ % nh sau: 2-Clo-2Metyl-Butan: 28,4% 1-Clo-2Metyl-Butan: 24,4% 3-Clo-2Metyl-Butan: 35,0% 4-Clo-2Metyl-Butan: 12,2% 1. ViÕt ph¬ng tr×nh ph¶n øng (dïng c«ng thøc cÊu t¹o) vµ c¬ chÕ ph¶n øng. 2. NÕu thay Clo b»ng Brom th× c¸c tØ lÖ % trªn biÕn ®æi thÕ nµo? Gi¶i thÝch. 3. H·y dù ®o¸n tØ lÖ % s¶n phÈm monoclo ho¸ Propan vµ IsoButan. C©u II: 1. Cã c¸c hîp chÊt sau: C2H5OH; n-C10H21OH; C6H5OH; C6H5CH2OH; C6H5NH2; HOCH2CHOHCH2OH; CH3COOH; n-C6H14; C5H6 vµ C6H12O6 (glucoz¬) a) Cho biÕt nh÷ng chÊt tan tèt, nh÷ng chÊt tan kÐm trong níc? Gi¶i thÝch. b) H·y viÕt c«ng thøc c¸c d¹ng liªn kÕt hi®ro gi÷a c¸c ph©n tö C6H5OH vµ C2H5OH. D¹ng nµo bÒn nhÊt, d¹ng nµo kÐm bÒn nhÊt? Gi¶i thÝch. 2. a) Khi nh×n Etan theo trôc däc liªn kÕt C-C ta thÊy r»ng c¸c nguyªn tö H nèi víi 2 nguyªn tö C kh«ng che khuÊt nhau tõng cÆp mét mµ xen kÏ nhau. M« t¶ hiÖn tîng nµy b»ng c«ng thøc vµ gi¶i thÝch. b) NÕu nh×n ph©n tö n-Butan theo däc trôc liªn kÕt C 2-C3 ta sÏ thÊy cã bao nhiªu d¹ng xen kÏ nh vËy? D¹ng nµo chiÕm u thÕ h¬n? V× sao? C©u III: §Æc ®iÓm cña ph¶n øng este ho¸ lµ thuËn nghÞch? Tuyeån taäp ñeà thi hoïc sinh gioûi Quoác Gia Trang:6 ********************************************************************************************************************************* 1. Nªu c¸c biÖn ph¸p ®Ó ph¶n øng nhanh ®¹t tíi tr¹ng th¸i c©n b»ng. Nªu c¸c biÖn ph¸p chuyÓn dÞch c©n b»ng ho¸ häc vÒ phÝa t¹o thµnh este. 2. ThiÕt lËp biÓu thøc tÝnh h»ng sè c©n b»ng K, gi¶ sö cho a mol axit axetic ph¶n øng víi b mol rîu etylic vµ sau khi ph¶n øng ®¹t tíi tr¹ng th¸i c©n b»ng ®· thu ®îc c mol este. - TÝnh gi¸ trÞ cña K khi a =b =1mol vµ c = 0,655 mol - NÕu a = 1mol vµ b t¨ng gÊp 5 lÇn th× lîng este t¨ng gÊp bao nhiªu lÇn? C©u IV: 1. Hîp chÊt A (C18H18O2Br2) ph¶n øng ®îc víi dd NaOH nãng. Cho hçn hîp sau ph¶n øng t¸c dông víi dd axit v« c¬ lo·ng, thu ®îc B (C9H9O2Br) vµ C (C9H11OBr). Oxi ho¸ B hoÆc C ®Òu thu ®îc axit para-brom-benzoic. Oxi ho¸ trong ®iÒu kiÖn thÝch hîp C chuyÓn thµnh B. Tõ B thùc hiÖn chuyÓn ho¸ theo s¬ ®å sau: Cl2 ,as ddHCl H 2SO 4 ,170o C ddNaOH,t o B ��� � G ����� � D ���� � E ��� �H (D chøa 1 nguyªn tö Clo trong ph©n tö, H cã ®ång ph©n Cis-trans. C¸c s¶n phÈm D, E, G, H ®Òu lµ s¶n phÈm chÝnh) a) ViÕt c«ng thøc cÊu t¹o cña A, B, C, D, E, G, H vµ viÕt c¸c ph¬ng tr×nh ph¶n øng x¶y ra. b) So s¸nh nhiÖt ®é nãng ch¶y cña B vµ C. Gi¶i thÝch. 2. Heliotropin C8H6O3 (chÊt ®Þnh híng trong c«ng nghiÖp h¬ng liÖu) ®îc ®iÒu chÕ tõ chÊt safrol C10H10O2 (trong tinh dÇu x¸ xÞ) b»ng c¸ch ®ång ph©n ho¸ safrol thµnh Isosafrol C 10H10O2, sau ®ã oxi ho¸ isosafrol nhê chÊt oxi ho¸ thÝch hîp. ViÕt c«ng thøc cÊu t¹o cña Heliotropin, safrol vµ isosafrol. BiÕt r»ng heliotropin ph¶n øng ®îc víi AgNO3 trong dd NH3 cho muèi cña axit 3,4-metylen dioxiBenzoic vµ isosafrol cã ®ång ph©n cis-trans 3. C¸c chÊt Freon g©y ra hiÖn tîng “lç thñng «zon”. C¬ chÕ ph©n huû «zon bëi Freon (thÝ dô CF2Cl2) viÕt nh sau: COOH h � Cl + CF2Cl CF2Cl2 ��� (a) O3 + Cl �� (b) � O2 + ClO  O + ClO �� (c) � O2 + Cl O a) Gi¶i thÝch v× sao 1 ph©n tö CF2Cl2 cã thÓ ph©n huû hµng chôc ngµn ph©n tö Ozon? O CH2tîng “lç thñng b) Trong khÝ quyÓn cã 1 lîng nhá khÝ Metan. HiÖn tîng g× x¶y ra ®ång thêi víi hiÖn ozon”? Gi¶i thÝch. C©u V: Tæng thÓ tÝch (ë 0oC) cña Hi®rocacbon A (khÝ) vµ thÓ tÝch võa ®ñ O2 ®Ó ®èt ch¸y hoµn toµn A b»ng 1/2 thÓ tÝch cña c¸c s¶n phÈm ch¸y ë 195oC. Sau khi lµm l¹nh ®Õn 0oC thÓ tÝch cña c¸c s¶n phÈm ch¸y cßn b»ng 1/2 thÓ tÝch ban ®Çu cña hçn hîp A vµ O2. C¸c thÓ tÝch ®Òu ®o ë cïng ¸p suÊt. 1. ViÕt c«ng thøc cÊu t¹o A. 2. Thùc hiÖn ph¶n øng t¸ch Hi®ro tõ A thu ®îc hçn hîp s¶n phÈm B. §èt ch¸y hoµn toµn 4,032 lÝt B (®ktc) thu ®îc 6,72 lÝt CO2 (®ktc). DÉn 0,252 lÝt B (®ktc) qua dd Br 2 lµm cho khèi lîng dd nÆng thªm 0,21 gam. TÝnh thµnh phÇn % thÓ tÝch cña hçn hîp B. Gi¶ sö chØ x¶y ra sù t¸ch Hi®ro. Bé Gi¸o Dôc Vµ §µo T¹o §Ò Thi Quèc Gia Chän HäC SINH Giái THPT M«n Thi: Ho¸ Häc Líp 12 Ngµy thi: 14/3/1997 (180 phót, kh«ng kÓ thêi gian giao ®Ò ) B¶ng A: Lµm tÊt c¶ c¸c c©u B¶ng B: Kh«ng lµm phÇn V C©u I: 1. H·y xÕp c¸c c«ng thøc sau ®©y theo thø tù t¨ng dÇn sè oxi ho¸ cña N: N 2, NO, NH3, N2O, NH2OH, HNO3, N2H4, NO2, HNO2. H·y chØ râ nguyªn nh©n vÒ cÊu t¹o nguyªn tö ®Ó N cã sè c¸c oxi ho¸ ®ã. 2. Cho c¸c chÊt sau: a) Na2CO3; b) KNO3; c) (NH4)2SO4; d) BaCl2; e) KHSO4 Gi¶i thÝch tÝnh chÊt axit-baz¬ cña c¸c dd níc cña c¸c chÊt trªn. Cho biÕt gi¸ trÞ íc lîng pH cña c¸c dd ®ã (pH > 7; < 7 hoÆc  7 ?). 3. ÔÛ tÇng trªn cña khÝ quyÓn cã líp ozon lµm l¸ ch¾n b¶o vÖ tr¸i ®Êt khái t¸c h¹i cña tia cùc tÝm do mÆt trêi räi xuèng nhê duy tr× c©n b»ng ho¸ häc. hv O2 + O O3 Tuyeån taäp ñeà thi hoïc sinh gioûi Quoác Gia Trang:7 ********************************************************************************************************************************* GÇn ®©y c©n b»ng nµy bÞ ph¸ vì, lµ mét trong nh÷ng hØÓm ho¹ vÒ m«i tr êng trªn tr¸i ®Êt. Mét trong c¸c nguyªn nh©n lµ con ngêi th¶i vµo khÝ quyÓn mét lîng ®¸ng kÓ NO vµ Cl (Cl do clo-flo cacbon tõ c¸c m¸y l¹nh tho¸t vµo kh«ng khÝ t¹o ra hv CF 2Cl2  CF2Cl + Cl ); C¸c khÝ nµy lµm xóc t¸c cho qu¸ tr×nh biÕn ®æi O3 thµnh O2. H·y viÕt pt pø (riªng rÏ vµ tæng céng) ®Ó chøng minh vai trß xóc t¸c ®ã cña Cl vµ NO. C©u II: KMnO4 lµ thuèc thö ®îc dïng ®Ó x¸c ®Þnh nång ®é c¸c muèi s¾t (II). Ph¶n øng gi÷a KMnO 4 vµ FeSO4 trong dung dÞch H2SO4 diÔn ra theo s¬ ®å: KMnO4 + FeSO4 + H2SO4 �� � K2SO4 + MnO4 + Fe2(SO4)3 + H2O (1) 1. H·y viÕt ph¬ng tr×nh ph¶n øng (1) díi d¹ng ph¬ng tr×nh ion (kÝ hiÖu ph¬ng tr×nh ion lµ (2)). 2. Gi¶ thiÕt ph¶n øng ®ã lµ thuËn nghÞch, h·y thiÕt lËp biÓu thøc h»ng sè c©n b»ng cña ph¶n øng dùa vµo (2) theo nång ®é c©n b»ng cña c¸c chÊt. 3. Gi¸ trÞ logarit h»ng sè c©n b»ng cña ph¶n øng oxi ho¸-khö ë 25 oC dîc tÝnh theo biÓu thøc: lgK = nE0 0.059 (E0 lµ hiÖu thÕ ®iÖn cùc tiªu chuÈn cña c¸c cÆp chÊt ph¶n øng, n lµ sè electron tham gia vµo qu¸ tr×nh oxi ho¸ hoÆc khö trong ph¶n øng). H·y tÝnh h»ng sè c©n b»ng cña ph¶n øng theo (2). 0 o 0 Cho E MnO-4 /Mn 2+ = 1,51V; E Fe3+ /Fe2+ = 0,77V; E Cl2 /2Cl- = 1,36V 4. Trong mét hçn hîp gåm cã KMnO4 0,010M; H2SO4 0,500M; FÐO4 0,020M vµ Fe2(SO4)3 0,005M. H·y tÝnh nång ®é c¸c ion khi ph¶n øng kÕt thóc. 5. Mçi yÕu tè sau ®©y ¶nh hëng nh thÕ nµo ®Õn (2): a) T¨ng pH cña dung dÞch; b) Thay H2SO4 b»ng HCl c) Thªm lîng nhá KSCN vµo dung dÞch. C©u III: 1. Hoµn thµnh c¸c ph¬ng tr×nh ph¶n øng h¹t nh©n sau: a) ? �� � 82Pb206 + 2He4 17 b) 9F �� � 8O17 + ? 239 c) 94Pu �� � ? + 2He4 1 d) + ? �� 1H � 2He4 e) ? + 1D2 �� � 2 2He4 §èi víi mçi ®Þnh luËt b¶o toµn dîc ¸p dông ®Ó lËp ph¬ng tr×nh trªn, h·y ph©n tÝch mét vÝ dô ®Ó minh ho¹. 2.a) Uran trong thiªn nhiªn chøa 99,28% U238 (cã thêi gian b¸n huû lµ 4,5.109n¨m) vµ 0,72% U235 (cã thêi gian b¸n huû lµ 7,1.108n¨m). TÝnh tèc ®é ph©n r· mçi ®ång vÞ trªn trong 10gam U3O5 míi ®iÒu chÕ. b) Mari vµ Pie Curi diÒu chÕ Ra226 tõ quÆng Uran trong thiªn nhiªn. Ra226 dîc t¹o ra tõ ®ång vÞ nµo trong hai ®ång vÞ trªn? C©u IV: 1. H·y viÕt ph¬ng tr×nh ph¶n øng x¶y ra khi dÉn lîng d khÝ H2S sôc qua dung dÞch (cã pH  0,5) chøa c¸c ion Ag+, Ba2+, Cr2O72-, Cu2+, Fe3+, Ni2+. 2. Cã dd muèi nitrat cña Mg2+, Ba2+, Al3+, Cr3+, Co2+, Ag+, Hg22+ (kÝ hiÖu lµ dd 1). H·y viÕt ph¬ng tr×nh ph¶n øng x¶y ra trong mçi trêng hîp sau ®©y: a) Thªm dd NaCl vµo dd 1 tíi khi kÕt tña ®îc hoµn toµn. Läc lÊy kÕt tña (kÝ hiÖu a), dd cßn l¹i (kÝ hiÖu lµ dd2). b) Röa kÕt tña a b»ng níc råi cho t¸c dông tiÕp víi dd NH3 6M. c) §un c¸ch thuû tíi nãng dd 2, thªm vµo ®ã NH4Cl r¾n, råi thªm tiÕp NH3 6M tíi pH  9,0. d) Cho kÕt tña thu dîc ë c) t¸c dông víi NaOH 2M cã mét Ýt dd H2O2. C©u V: XÐt ph¶n øng N2(khÝ) + 3H2(khÝ) �� ��� � 2NH3(khÝ) (I) 1) T¹i ®iÒu kiÖn tiªu chuÈn ®èi víi c¸c chÊt, T = 298K, cã: So = -197,9J.K-1; Ho = -91,8kJ. TÝnh Go vµ kÕt luËn vÒ kh¶ n¨ng x¶y ra ph¶n øng (I). 2) Còng t¹i 298K, cã PN2 = PH2 = 10,0atm; PNH3 = 1,0atm. a) TÝnh G = Go + 2,303RTlg Kp víi Kp = P2NH3/P3H2PN2 vµ R = 8,31 J.K-1. b) Dùa vµo c¸c sè liÖu tÝnh ®îc ë trªn, gi¶i thÝch møc ®é x¶y ra ph¶n øng (I) ë hai trêng hîp 1) vµ 2). KÕt qu¶ ®ã cã phï hîp víi nguyªn lý L¬ Sat¬liª hay kh«ng? T¹i sao? Tuyeån taäp ñeà thi hoïc sinh gioûi Quoác Gia Trang:8 ********************************************************************************************************************************* Bé Gi¸o Dôc Vµ §µo T¹o §Ò Thi Quèc Gia Chän HäC SINH Giái THPT M«n Thi: Ho¸ Häc Líp 12 Ngµy thi: 15/3/1997 (180 phót, kh«ng kÓ thêi gian giao ®Ò ) B¶ng A: Lµm tÊt c¶ c¸c c©u B¶ng B: Kh«ng lµm c©u VI C©u I: 1. H·y cho biÕt kiÓu lai ho¸ cña c¸c nguyªn tè vµ lo¹i liªn kÕt (, ) trong c¸c hîp chÊt sau: Cl-CH2-CH =O; CH2=CH - CN; CH2 = C = O 2. H·y s¾p xÕp c¸c hîp chÊt cho díi ®©y theo thø tù t¨ng dÇn nhiÖt ®é s«i. Gi¶i thÝch. CH3-CH2-CH2-CH3 (A); CH3-CH2-CH2OH (B); CH3-CH2-CH2NH2 (C); (CH3)3CH (D); (CH3)3N (E). 3. Cã thÓ thùc hiÖn ®îc c¸c ph¶n øng sau hay kh«ng, v× sao? C2H5ONa + CH3COOH  C2H5OH + CH3COONa (1) NaNH2 + CH4  CH3Na + NH3 (2) C©u II: 1. Hîp chÊt X chøa 60% C, 4,44%H vµ 35,56%O trong ph©n tö, dd níc cña X lµm hång quú tÝm. Thuû ph©n X thu ®îc axit axetic vµ axit o-hi®roxibenzoic. a) X¸c ®Þnh c«ng thøc cÊu t¹o cña X, biÕt MX = 180®vC. b) TÝnh thÓ tÝch võa ®ñ dd NaOH 0,5M ®Ó ph¶n øng hoµn toµn víi 5,4g X. 2. Mannoz¬ (monosaccarit) HOCH2-(CHOH)4-CH=O lµ ®ång ph©n cña glucoz¬. ë d¹ng vßng 6 c¹nh mannoz¬ chØ kh¸c glucoz¬ ë chç nhãm OH ë nguyªn tö C2 n»m cïng phÝa víi OH ë nguyªn tö C3. Oxi ho¸ mannoz¬ b»ng dd HNO 3 ë 100oC thu ®îc s¶n phÈm Y chøa 41,38%C; 3,45%H vµ 55,17%O. Y bÞ thuû ph©n c¶ trong m«i trêng axit còng nh baz¬ t¹o ra axit polihi®roxi®icacboxylic hoÆc muèi t¬ng øng. X¸c ®Þnh c«ng thøc cÊu t¹o cña Y, biÕt MY = 174 ®vC. C©u III: Tõ mét lo¹i tinh dÇu ngêi ta t¸ch ®îc chÊt A chøa 76,92%C; 12,82%H vµ 10,26%O trong ph©n tö, MA = 156 ®vC. A cßn ®îc ®iÒu chÕ b»ng c¸ch hi®ro ho¸ xóc t¸c chÊt 2-isopropyl-5-metylphenol (B). 1. X¸c ®Þnh c«ng thøc cÊu t¹o cña A. 2. ViÕt c«ng thøc c¸c ®ång ph©n cis-trans cña A. 3. §un nãng A víi H2SO4 ®Æc thu ®îc hai chÊt cã cïng c«ng thøc ph©n tö C 10H18. ViÕt c«ng thøc cÊu t¹o cña hai chÊt ®ã vµ viÕt c¬ chÕ ph¶n øng. 4. So s¸nh tÝnh chÊt axit cña A víi B. C©u IV: Thuû ph©n hoµn toµn 1 mol polipeptit X cho ta: 2 mol CH3- CH(NH2) - COOH (Alanin hay viÕt t¾t lµ Ala) 1 mol HOOC - CH2 - CH2 - CH(NH2) - COOH (axit glutamic hay Glu) 1 mol H2N -(CH2)4 - CH(NH2) - COOH (Lizin hay Lys) N 1 mol CH2 CH COOH Histidin hay His NH2 N H NÕu cho X t¸c dông víi 2,4-(NO2)2C6H3F (kÝ hiÖu ArF) råi míi thuû ph©n th× thu ®îc Ala, Glu, Lys vµ hîp chÊt N CH2 N H CH COOH NH Ar MÆt kh¸c nÕu thuû ph©n X nhê enzim cacboxipepti®aza th× thu ®îc Lys vµ mét tetrapeptit. Ngoµi ra khi thuû ph©n kh«ng hoµn toµn X cho ta c¸c ®ipeptit Ala-Glu, Ala-Ala vµ His-Ala. 1. X¸c ®Þnh c«ng thøc cÊu t¹o vµ tªn cña polipeptit X. 2. S¾p xÕp c¸c aminoaxit ë trªn theo thø tù t¨ng dÇn pH1 (pH 1 ®îc gäi lµ ®iÓm ®¼ng ®iÖn, t¹i pH ®ã aminoaxit tån t¹i ë d¹ng ion lìng cùc trung hoµ vÒ ®iÖn tÝch vµ kh«ng di chuyÓn vÒ mét ®iÖn cùc nµo c¶), biÕt c¸c gi¸ trÞ pH1 lµ 3,22; 6,00; 7,59 vµ 9,74. 3. ViÕt c«ng thøc cÊu t¹o d¹ng chñ yÕu cña mçi aminoaxit trªn ë c¸c pH b»ng 1 vµ 13. 4. Díi t¸c dông cña enzim thÝch hîp aminoaxit cã thÓ bÞ ®ecacboxyl ho¸ (t¸ch nhãm cacboxyl). ViÕt c«ng thøc cÊu t¹o cña c¸c s¶n phÈm ®ecacboxyl ho¸ Ala vµ His. So s¸nh tÝnh baz¬ cña c¸c nguyªn tö nit¬ trong ph©n tö gi÷a hai s¶n phÈm ®ã. Gi¶i thÝch. Tuyeån taäp ñeà thi hoïc sinh gioûi Quoác Gia Trang:9 ********************************************************************************************************************************* C©u V: Tõ dÉn xuÊt halogen cã thÓ ®iÒu chÕ axit cacboxylic theo s¬ ®å sau:  HX � CO Mg 2 � RCOOMgX ���� RX ����� RCOOH � RMgX ����� -MgX ete khan ete khan 2 Tõ CH4 vµ c¸c chÊt v« c¬ cÇn thiÕt h·y viÕt ph¬ng tr×nh c¸c ph¶n øng ®iÒu chÕ: 1. Axit metylmaloic CH3CH(COOH)2 2. Axit -vinylacrilic. C©u VI: Cã ph¬ng tr×nh ph¶n øng sau: OH 0 H2SO4 85 % , 10 C (A) + H2O (B) h = 55% 1.ViÕt c¬ chÕ ph¶n øng. 2.Thay A b»ng C6H5-CH(CH3)-CH2-CH2-C(CH3)2OH (A1), C6H5-CH2-CH2-C(CH3)2OH (A2) vµ tiÕn hµnh ph¶n øng trong ®iÒu kiÖn t¬ng tù nh trªn thu ®îc s¶n phÈm h÷u c¬ t¬ng øng B1 (hiÖu suÊt 86%), B2 (hiÖu suÊt 65%). a) ViÕt c«ng thøc cÊu t¹o cña B1, B2. b) T¹i sao hiÖu suÊt ph¶n øng t¹o ra B1, B2 cao h¬n t¹o ra B? Bé Gi¸o Dôc Vµ §µo T¹o §Ò Thi Quèc Gia Chän HäC SINH Giái THPT M«n Thi: Ho¸ Häc Líp 12 Ngµy thi: 13/3/1998 (180 phót, kh«ng kÓ thêi gian giao ®Ò ) B¶ng A: Lµm tÊt c¶ c¸c bµi B¶ng B: Kh«ng lµm nh÷ng c©u cã dÊu * Bµi I: 1. Trong thiªn nhiªn Brom cã chñ yÕu ë níc biÓn díi d¹ng NaBr. C«ng nghiÖp ho¸ häc ®iÒu chÕ Brom tõ níc biÓn theo qui tr×nh nh sau: Cho mét lîng dd H2SO4 vµo mét lîng níc biÓn; tiÕp ®Õn sôc khÝ Clo vµo dd míi thu ®îc; sau ®ã dïng kh«ng khÝ l«i cuèn h¬i Brom vµo dd Na 2CO3 tíi b·o hoµ Brom. Cuèi cïng cho H 2SO4 vµo dd ®· b·o hoµ Brom, thu h¬i Brom råi ho¸ láng. H·y viÕt ph¬ng tr×nh c¸c ph¶n øng ho¸ häc chñ yÕu x¶y ra trong qu¸ tr×nh ®ã vµ cho biÕt vai trß cña H2SO4. 2. Brom láng hay h¬i ®Òu rÊt ®éc. H·y viÕt ph¬ng tr×nh ph¶n øng ho¸ häc x¶y ra khi dïng mét ho¸ chÊt th«ng thêng dÔ kiÕm ®Ó huû hÕt lîng Brom láng ch¼ng may bÞ lµm ®æ, b¶o vÖ m«i trêng. Bµi II: Dïng 94,96ml H2SO4 5% (D = 1,035g/ml) võa ®ñ t¸c dông hÕt víi 2,80 g chÊt X, thu ®îc muèi Y vµ chÊt Z. 1. X, Y, Z cã thÓ lµ nh÷ng chÊt nµo? H·y gi¶i thÝch cô thÓ vµ viÕt ph¬ng tr×nh ph¶n øng ho¸ häc ®Ó minh ho¹. 2. NÕu sau qu¸ tr×nh trªn thu ®îc 7,60 g muèi Y th× sÏ ®îc bao nhiªu chÊt Z? BiÕt r»ng X cã thÓ lµ mét trong c¸c chÊt: CaO, MgO, NaOH, KOH, Zn, Fe. Bµi III: 1.T×m ph¬ng tr×nh cho mçi ph¶n øng ho¸ häc sau ®©y: a) K2Cr2O7 + ? + H2O  Cr(OH)3 + S + NH3 + KOH b) K2Cr2O7 + Na2SO3 + H2SO4  ? + Na2SO4 + K2SO4 + H2O c) K2Cr2O7 + (NH4)2S + ? + H2O  K3[Cr(OH)6] + S + ? 2. H·y cho biÕt chÊt oxi ho¸ trong mçi ph¶n øng trªn. Dùa vµo cÊu h×nh electron cña nguyªn tö, h·y gi¶i thÝch tÝnh chÊt oxi ho¸ cña chÊt ®ã. 3*). H·y cho biÕt vai trß cña pH ®èi víi c¸c ph¶n øng ho¸ häc trªn trong sù t¹o thµnh c¸c s¶n phÈm chøa crom. Bµi IV: Cã sè liÖu: §iÖn cùc ThÕ ®iÖn cùc tiªu chuÈn (V) ë 25oC H / H+ -2,106. Fe / Fe2+ -0.440. Fe / Fe3+ -0.036. H2 / 2H+ 0,000. 1. H·y viÕt ph¬ng tr×nh ph¶n øng gi÷a Fe víi axit HCl vµ dïng sè liÖu trªn ®Ó gi¶i thÝch kÕt qu¶ cña ph¶n øng ®ã. Tuyeån taäp ñeà thi hoïc sinh gioûi Quoác Gia Trang:10 ********************************************************************************************************************************* 2. Thùc tÕ ®· dïng t¸c nh©n nµo trong sè c¸c t¸c nh©n: Fe, H, H 2, ®Ó khö nitrobenzen thµnh anilin? ViÕt ph¬ng tr×nh ph¶n øng vµ dïng sè liÖu trªn ®Ó gi¶i thÝch. 3*). H·y ®Ò nghÞ s¬ ®å trong ®ã cã chØ râ liªn hÖ gi÷a c¸c chÊt b»ng mòi tªn () ®Ó dùa vµo ®ã vµ dïng sè liÖu trªn tÝnh ®îc thÕ ®iÖn cùc tiªu chuÈn cña qu¸ tr×nh Fe3+  Fe2+; kÝ hiÖu trÞ sè ®ã lµ x. H·y ®Æt x vµo vÞ trÝ thÝch hîp trong d·y sè liÖu mµ ®Çu bµi ®· ®a ra. Bµi V: 1. H·y so s¸nh ®é tan cña SO2 trong dd níc cã cïng nång ®é cña c¸c chÊt sau: a) NaCl; b) HCl; c) NH4Cl; d) Na2S. 2*). DÉn tõ tõ SO2 qua mét lÝt dd Ca(OH)2 (dd A). Sau ph¶n øng thu ®îc dd cã pH = 12,0 vµ kÕt tña CaSO3. Läc lÊy kÕt tña råi lµm kh« c©n nÆng 1,200 gam. a) H·y tÝnh thÓ tÝch SO2 ë 27,3oC, 1atm ®· tan ®îc vµo dd A. b) TÝnh nång ®é mol/lÝt cña Ca(OH)2 trong dd A. 3. Cho NaOH d vµo dd X chøa c¸c ion H +, Cr2O72-, Pb2+, Ba2+, NH4+. §un nãng dd ta sÏ ®îc khÝ mïi khai bay ra vµ cã kÕt tña vµng. Läc kÕt tña, råi cho t¸c dông víi dd HCl. Khi Êy ta ®îc dd mµu da cam vµ mét kÕt tña mµu tr¾ng. ViÕt c¸c ph¬ng tr×nh ph¶n øng ®Ó gi¶i thÝch c¸c hiÖn tîng. Bé Gi¸o Dôc Vµ §µo T¹o §Ò Thi Quèc Gia Chän HäC SINH Giái THPT M«n Thi: Ho¸ Häc Líp 12 Ngµy thi: 14/3/1998 (180 phót, kh«ng kÓ thêi gian giao ®Ò ) B¶ng A: lµm tÊt c¶ c¸c bµi B¶ng B: kh«ng lµm nh÷ng c©u cã dÊu* Bµi I: 1. Cho 4 dÉn xuÊt clo cña hi®rocacbon, chóng ®Òu cã c«ng thøc ph©n tö C4H9Cl. a) ViÕt c«ng thøc cÊu t¹o thu gän vµ gäi tªn 4 chÊt ®ã theo danh ph¸p th«ng dông vµ IUPAC. S¾p xÕp chóng theo tr×nh tù t¨ng dÇn nhiÖt ®é s«i. Gi¶i thÝch. b*) Cho dÉn xuÊt clo m¹ch kh«ng nh¸nh ë trªn t¸c dông víi clo (chiÕu s¸ng) theo tû lÖ mol 1:1. Tr×nh bµy c¬ chÕ cña ph¶n øng. Cho biÕt s¶n phÈm nµo chiÕm tØ lÖ cao nhÊt; gi¶i thÝch. 2. ViÕt c«ng thøc cÊu tróc c¸c ®ång ph©n cña: a) C3H5Cl b) ClCH =(C=)nCHCl, víi n = 1, 2, 3. Bµi II: 1. ViÕt c¸c ph¬ng tr×nh ph¶n øng t¹o thµnh s¶n phÈm chÝnh khi cho 1mol hi®rocacbon A t¸c dông víi c¸c chÊt sau: a) 1mol HNO3(cã H2SO4®Æc); b) 1mol Br2(cã chiÕu s¸ng); c) KMnO4®Æc,d(®un nãng). d*) Tr×nh bµy giai ®o¹n quyÕt ®Þnh tèc ®é chung cña mçi ph¶n øng a)vµ b). 2*. Iotbenzen ®îc ®iÒu chÕ víi hiÖu suÊt cao theo s¬ ®å ph¶n øng sau: 300 C� NO + NO2 + AgI C6H6 + I2 + HNO3 ���� Cho biÕt vai trß cña HNO3? Nªu tªn c¬ chÕ ph¶n øng. Bµi III: 1. ViÕt c¸c ph¬ng tr×nh ph¶n øng x¶y ra trong c¸c trêng hîp sau(A, B, C, D, E, G, H, I, K, L viÕt d¹ng c«ng thøc cÊu tróc ): 0 H2, Ni, t C A a) C6H5 C C COOCH3 H2, Pd, PbCO3 B o dd HCl� D HOCH2 -CH2OH, to b. b) p-CH3C6H4CH3 dd KMnO4 d�,t C ���� E ���������� � ���������� � Tuyeån taäp ñeà thi hoïc sinh gioûi Quoác Gia Trang:11 ********************************************************************************************************************************* c) o-CH3C6H4CH3 C H5OH(d� ) dd KMnO d�,to 2 dd HCl� H ������� G ���� I 4 ���������� � H2SO4 � � c, to � � c, 1400 C dd NaOH, to � K H2SO4 � d) o-BrCH2C6H4CH2Br ������� ��������� � L Cho biÕt øng dông cña E vµ I. 2. H·y ph©n biÖt 4 aminoaxit sau (cã gi¶i thÝch), biÕt r»ng phßng thÝ nghiÖm cã c¸c lo¹i giÊy quú, dd NaNO 2+ dd HCl, ddNaOH, C2H5OH vµ c¸c dông cô cÇn thiÕt. a) CH3-CH-COOH (Ala) b) H2N-(CH2)4-CH-COOH (Lys) NH2 NH2 c) HOOC-(CH2)2-CH-COOH (Glu) d. N COOH (Pro) H Bµi IV: 1. Trong thuèc l¸ cã chÊt anabazin vµ mét ®ång ph©n cÊu t¹o cña nã lµ nicotin (rÊt ®éc). Ngoµi ra ngêi ta cßn tæng hîp ®îc chÊt nicotirin cã cÊu t¹o t¬ng tù nicotin: CH3 N N N N CH3 Nicotin N H Anabazin Nicotirin a) ViÕt ph¬ng tr×nh ph¶n øng x¶y ra khi cho mçi hîp chÊt trªn t¸c dông víi HCl theo tØ lÖ mol 1:1. S¾p xÕp chóng theo tr×nh tù t¨ng dÇn kh¶ n¨ng ph¶n øng ®ã. Gi¶i thÝch. b) Trong sè 3 hîp chÊt trªn, chÊt nµo cã nhiÖt ®é s«i cao nhÊt? Gi¶i thÝch. 2. Oxi ho¸ nicotin b»ng K2Cr2O7 trong dd H2SO4 thu ®îc axit nicotinic dïng ®Ó ®iÒu chÕ c¸c amit cña nã lµ vitamin PP vµ co®iamin (thuèc ch÷a bÖnh tim): CONH2 N Nicotiamit Vitamin PP C N(C2H5)2 O Codiamin ViÕt c«ng thøc cÊu t¹o cña axit nicotinic vµ so s¸nh nhiÖt ®é nãng ch¶y cña nã víi axit benzoic. Gi¶i thÝch. b*) Cho biÕt tr¹ng th¸i lai ho¸ cña c¸c nguyªn tö nit¬ trong ph©n tö vitamin PP. So s¸nh tÝnh baz¬ cña c¸c nguyªn tö nit¬ ®ã: gi¶i thÝch. c) Vitamin PP nãng ch¶y ë nhiÖt ®é cao h¬n co®iamin, mÆc dï cã ph©n tö khèi nhá h¬n. T¹i sao? Bµi V: 1*) A lµ mét ®isaccarit khö ®îc AgNO3 trong dd NH3, gåm hai ®ång ph©n cã kh¶ n¨ng lµm quay mÆt ph¼ng ¸nh s¸ng ph©n cùc trong nh÷ng ®iÒu kiÖn thèng nhÊt biÓu thÞ b»ng []25D lµ +92,6o vµ +34o. Dung dÞch cña mçi ®ång ph©n nµy tù biÕn ®æi vÒ []25D cho tíi khi cïng ®¹t gi¸ trÞ æn ®Þnh lµ + 52o. Thuû ph©n A (nhê chÊt xóc t¸c axit) sinh ra B vµ C: CHO CHO H OH H OH HO H HO H HO H H OH H OH H OH CH2OH (B) CH2OH (C) Tuyeån taäp ñeà thi hoïc sinh gioûi Quoác Gia Trang:12 ********************************************************************************************************************************* Cho A t¸c dông víi mét lîng d CH3I trong m«i trêng baz¬ thu ®îc s¶n phÈm D kh«ng cã tÝnh khö. §un nãng D víi dd axit lo·ng thu ®îc dÉn xuÊt 2,3,6-tri-O-metyl cña B vµ dÉn xuÊt 2,3,4,6-tetra-O-metyl cña C. a) ViÕt c«ng thøc cÊu tróc (d¹ng vßng 6 c¹nh ph¼ng) cña B, C, A, D; biÕt r»ng trong ph©n tö A cã liªn kÕt  1,4 - glicozit. Gi¶i thÝch vµ viÕt c¸c ph¬ng tr×nh ph¶n øng. b) V× sao dd mçi ®ång ph©n cña A tù biÕn ®æi vÒ []25D vµ cuèi cïng ®Òu ®¹t gi¸ trÞ 52o? TÝnh thµnh phÇn phÇn tr¨m c¸c chÊt trong dd ë gi¸ trÞ []25D = 525 vµ viÕt c«ng thøc cÊu tróc cña c¸c chÊt thµnh phÇn ®ã. 2. Metyl ho¸ hoµn toµn c¸c nhãm OH cña 3,24 gam amilopectin b»ng c¸ch cho t¸c dông víi CH 3I trong m«i trêng baz¬, råi ®em thuû ph©n hoµn toµn (xóc t¸c axit) th× thu ®îc 1,66.10-3 mol 2,3,4,6 - tetra - O metylglucoz¬ vµ 1,66.10-3 mol 2,3 - ®i - O - metylglucoz¬; cßn l¹i lµ 2,3,6 - tri - O - metylglucoz¬. a)ViÕt c«ng thøc cÊu tróc (d¹ng vßng 6 c¹nh ph¼ng) cña 3 s¶n phÈm trªn vµ cho biÕt xuÊt xø cña chóng. b) Cho biÕt tØ lÖ phÇn tr¨m c¸c gèc glucoz¬ ë nh÷ng chç cã nh¸nh cña ph©n tö amilopectin. c) TÝnh sè mol 2,3,6 - tri - O - metylglucoz¬ sinh ra trong phßng thÝ nghiÖm trªn. Bé Gi¸o Dôc Vµ §µo T¹o ®Ò thi chÝnh thøc §Ò Thi Quèc Gia Chän HäC SINH Giái THPT M«n Thi: Ho¸ Häc - B¶ng A Ngµy thi: 12/3/1999 (180 phót, kh«ng kÓ thêi gian giao ®Ò ) C©u 1: Dung dÞch A gåm c¸c chÊt tan FeCl3, AlCl3, NH4Cl vµ CuCl2 (nång ®é mçi chÊt xÊp xØ 0,1M). 1. Dung dÞch A cã ph¶n øng axit, baz¬, trung tÝnh ? T¹i sao ? 2. Cho H2S léi chËm qua dung dÞch A cho ®Õn b·o hoµ th× thu ®îc kÕt tña vµ dung dÞch B. H·y cho biÕt thµnh phÇn c¸c chÊt trong kÕt tña vµ trong dung dÞch B. 3. Thªm dÇn NH3 vµo dung dÞch B cho ®Õn d. Cã hiÖn tîng g× x¶y ra ? ViÕt c¸c ph¬ng tr×nh ph¶n øng ion ®Ó gi¶i thÝch. C©u 2: 1. Ph«tgen ®îc dïng lµm chÊt clo ho¸ rÊt tèt cho ph¶n øng tæng hîp h÷u c¬, ®îc ®iÒu chÕ theo ph¬ng tr×nh: CO(k) + Cl2(k) �� ; Ho = -111,3 kJ.mol-1 ��� � COCl2(k) Magiª ®îc ®iÒu chÕ theo ph¬ng tr×nh: MgO(r) + C(r) �� ; Ho = 491,0 kJ.mol-1 ��� � Mg(r) + CO(k) CÇn t¸c ®éng nh thÕ nµo vµo nhiÖt ®é vµ ¸p suÊt riªng phÇn cña khÝ ®Ó mçi ph¶n øng trªn thu ®îc nhiÒu s¶n phÈm h¬n? T¹i sao ph¶i t¸c ®éng nh vËy ? 2.Thùc nghiÖm cho biÕt t¹i 25oC tèc ®é tiªu thô khÝ NO trong ph¶n øng ®iÒu chÕ nitrozoni clorua khÝ : 2NO (k) + Cl2 (k) �� (1) ��� � 2NOCl (k) -4 -1 -1 o b»ng 3,5.10 mol.l s . H·y tÝnh tèc ®é (t¹i 298 K): a) Cña ph¶n øng (1) b) Tiªu thô khÝ Cl2 c) T¹o thµnh NOCl (k) C©u 3: ClO2 lµ chÊt ho¸ chÊt ®îc dïng phæ biÕn trong c«ng nghiÖp. Thùc nghiÖm cho biÕt: 1.a/ Dung dÞch lo·ng ClO2 trong níc khi gÆp ¸nh s¸ng sÏ t¹o ra HCl, HClO3. b/ Trong dung dÞch kiÒm (nh NaOH) ClO2 nhanh chãng t¹o ra hçn hîp muèi clorit vµ clorat natri. 2.c/ ClO2 ®îc ®iÒu chÕ nhanh chãng b»ng c¸ch cho hçn hîp KClO3, H2C2O4 t¸c dông víi H2SO4 lo·ng. d/ Trong c«ng nghiÖp ClO2 ®îc ®iÒu chÕ b»ng c¸ch cho NaClO3 t¸c dông víi SO2 cã mÆt H2SO4 4M. H·y viÕt ph¬ng tr×nh ph¶n øng vµ nãi râ ®ã lµ ph¶n øng oxi ho¸- khö hay ph¶n øng trao ®æi ? T¹i sao ? (ph©n tÝch tõng ph¶n øng a, b, c, d). C©u 4: 1. Cã mét thÝ nghiÖm sau ®©y (lµm trong tñ hót khÝ ®éc): lÊy vµo èng nghiÖm 1ml axit sunfuric ®Æc, bá mét m¶nh ®ång vµo èng nghiÖm vµ ®un nãng nhÑ. a) Cã hiÖn tîng g× x¶y ra? B»ng c¸ch nµo nhËn biÕt s¶n phÈm khÝ cña ph¶n øng ? ViÕt ph¬ng tr×nh ph¶n øng x¶y ra. b) T¹i sao ph¶i ®un nãng nhÑ ? Tuyeån taäp ñeà thi hoïc sinh gioûi Quoác Gia Trang:13 ********************************************************************************************************************************* 2. Cã 3 dung dÞch Ba(OH)2, Pb(CH3COO)2, MgSO4 bÞ mÊt nh·n hiÖu. H·y chän 5 thuèc thö ®îc dïng ®Ó ph©n biÖt ®îc 3 dung dÞch trªn. ViÕt c¸c ph¬ng tr×nh ph¶n øng vµ gi¶i thÝch. C©u 5: TrÞ sè thÕ ®iÖn cùc tiªu chuÈn cña mét sè diÖn cùc cho trong b¶ng sau ®©y: §iÖn cùc Sè thø tù cña ®iÖn cùc ThÕ ®iÖn cùc chuÈn (V) Fe2+/Fe3+ 1 0,77 [Fe(CN)64-/[Fe(CN)632 0,36 NO, H2O/NO3-,H+ 3 0,96 NO2-, OH-/NO3-,H2O 4 0,10 Al/Al3+ 5 -1,66 sau). Dùa vµo sè liÖu trªn, h·y: 1. LËp c¸c pin, tÝnh hiÖu thÕ cña tõng pin (ghi kÕt qu¶ ®o ®îc theo thø tù gi¶m dÇn, thµnh b¶ng nh 2. ChØ râ ¶nh hëng cña pH ®Õn møc dé oxi hãa cña NO3-. Thø tù Pin gåm §iÖn cùc §iÖn cùc HiÖu thÕ cña pin (theo V) 3. ViÕt ph¬ng tr×nh ph¶n øng x¶y ra trªn mçi ®iÖn cùc vµ ph¶n øng x¶y ra trong mçi pin ®îc t¹o ra: a) Tõ ®iÖn cùc 2 víi ®iÖn cùc 5 b) Tõ diÖn cùc 3 víi ®iÖn cùc 5 c) Tõ ®iÖn cùc 3 víi ®iÖn cùc 4 Bé Gi¸o Dôc Vµ §µo T¹o ®Ò thi chÝnh thøc §Ò Thi Quèc Gia Chän HäC SINH Giái THPT M«n Thi: Ho¸ Häc - B¶ng A Ngµy thi: 13/3/1999 (180 phót, kh«ng kÓ thêi gian giao ®Ò ) C©u I: 1. H·y gäi tªn vµ s¾p xÕp c¸c hîp chÊt sau theo thø tù t¨ng dÇn nhiÖt ®é s«i. Gi¶i thÝch c¸ch s¾p xÕp ®ã: (CH3)4C ; CH3(CH2)4CH3 ; (CH3)2CHCH(CH3)2 CH3(CH2)3CH2OH ; (CH3)2C(OH)CH2CH3 2. H·y cho biÕt c¸c ph¶n øng díi ®©y thuéc lo¹i ph¶n øng nµo (oxi ho¸, khö hoÆc ph¶n øng kh¸c)? CrO ,piridin H CrO 3 2 4 a. CH3CH2OH ����� CH3COOH � CH3CH=O ���� (1) (2) � (2) (1) (2) H-COOH (3) H-CH=O (4) H CO b. CH4 �� � CH3OH �� � �� � �� � 2 3 LiAlH 4 c. CH3CH2OH ���� TiCl � 4 d. e. CHO CH3CH3 CH3OH, H+ CH(OCH3)2 + H2O Br + Br 2 Br f. Br + HBr C©u II: 1. ViÕt c¸c ph¬ng tr×nh ph¶n øng t¹o thµnh A, B, C, D, M, N (viÕt ë d¹ng c«ng thøc cÊu t¹o) theo s¬ ®å sau: CH3OH, HCl khan dd NaOH,t o a) BrCH2CH2CH2CH =O ����� � A ������� � � B o 1) dd NaOH, t H+ ,to b) BrCH2CH2CH2COOH ������� C ��� � D 2) dd HCl � Tuyeån taäp ñeà thi hoïc sinh gioûi Quoác Gia Trang:14 ********************************************************************************************************************************* Br2 , H2O H+ ,to N c) HOCH2(CHOH)4CH =O ���� � � M ��� 2. ViÕt ph¬ng tr×nh ph¶n øng ®iÒu chÕ 1,3,5-triaminobenzen tõ toluen vµ c¸c hîp chÊt v« c¬ thÝch hîp. C©u III: Tõ mét lo¹i thùc vËt ngßi ta CH=O t¸ch ®îc hîp chÊt (A) cã c«ng H OH thøc ph©n tö C18H32O16. Thuû HO H ph©n hoµn toµn (A) thu ®îc HO H glucoz¬ (B), fructoz¬ (C) vµ H OH glucoz¬ (D): CH2OH (D) 1. ViÕt c«ng thøc cÊu tróc d¹ng vßng ph¼ng 5 c¹nh vµ 6 c¹nh cña galactoz¬. 2. Hi®ro ho¸ glucoz¬, fructoz¬ vµ galactoz¬ thu ®îc c¸c poliancol (rîu ®a chøc). ViÕt c«ng thøc cÊu tróc cña c¸c poliancol t¬ng øng víi (B), (C) vµ (D). 3. Thuû ph©n kh«ng hoµn toµn (A) nhê enzim -galactozidaza (enzim xóc t¸c cho ph¶n øng thuû ph©n c¸c galactozit) thu ®îc galactoz¬ vµ saccaroz¬. Metyl ho¸ hoµn toµn (A) nhê hçn hîp CH 3I vµ Ag2O, sau ®è thuû ph©n s¶n phÈm metyl ho¸ thu ®îc 2,3,4,6-tetra-O-metyl galactoz¬ (E) vµ 2,3,4-tri-O-metyl glucoz¬ (G) vµ 1,3,4,6-tetra-O-metyl fructoz¬ (H). ViÕt c«ng thøc cÊu tróc cña (E), (G), (H) vµ (A). C©u IV: 1. a) §un nãng mét dÉn xuÊt tetraclo cña benzen víi dd NaOH (theo tØ lÖ mol 1:1) trong metanol, råi cho s¶n phÈm thu ®îc t¸c dông víi natri monocloaxetat vµ sau cïng lµ axit ho¸ th× thu ®îc chÊt diÖt cá 2,4,5-T. ViÕt s¬ ®å c¸c ph¶n øng ®· x¶y ra, gäi tªn chÊt ®Çu vµ c¸c s¶n phÈm, nªu tªn c¬ chÕ c¸c ph¶n øng ®ã. b) Trong qu¸ tr×nh tæng hîp 2,4,5-T nªu trªn ®· sinh ra mét s¶n phÈm phô cã ®éc tÝnh cùc m¹nh vµ lµ thµnh phÇn g©y ®éc m¹nh nhÊt cña chÊt ®éc mµu da cam , ®ã lµ chÊt ®éc ®ioxin: Cl O Cl Cl O Cl H·y tr×nh bµy s¬ ®å ph¶n øng t¹o thµnh ®ioxin. 2. a)Khi chÕ ho¸ hçn hîp c¸c ®ång ph©n kh«ng gian cña 2,3-®ibrom-3-metylpentan víi kÏm thu ®îc c¸c hi®rocacbon kh«ng no vµ kÏm bromua. ViÕt c«ng thøc cÊu tróc vµ gäi tªn c¸c hi®rocacbon ®ã. b)SÏ thu ®îc s¶n phÈm nµo b»ng ph¶n øng t¬ng tù nh trªn nÕu xuÊt ph¸t tõ 2,4-®ibrom-2-metylpentan. C©u V: 1. Axit xinamic ®îc ®iÒu chÕ theo s¬ ®å ph¶n øng sau: K 2CO3 , t o C6H5CH=O + (CH3CO)2O ����� C6H5CH=CHCOOH + CH3COOH � Khi kÕt thóc ph¶n øng ph¶i tiÕn hµnh t¸ch benzan®ehit d ra khái hçn hîp. Cã mét häc sinh ®· thùc hiÖn nh sau: cho dd KMnO4 ®Æc vµo hçn hîp ph¶n øng ®Ó lo¹i benzan®ehit d, sau ®ã axit ho¸ hçn hîp ®Õn m«i trêng axit ®Ó thu lÊy axit xinamic. C¸ch lµm nµy ®óng hay sai? Nªu mét ph¬ng ph¸p kh¸c ®Ó t¸ch ®îc axit xinamic tõ hçn hîp s¶n phÈm. 2. Trong phßng thÝ nghiÖm ngßi ta ®iÒu chÕ etilen b»ng c¸ch ®un nãng etanol víi H 2SO4 ®Æc ë kho¶ng 170oC. Gi¶i thÝch t¹i sao cÇn dÉn s¶n phÈm léi qua dd NaOH lo·ng. 3. B×nh cÇu A chøa ®Çy metylamin (tos = - 6,5oC) ®îc ®Ëy b»ng nót cao su cã l¾p èng thuû tinh, óp b×nh cÇu vµo chËu B chøa níc cã thªm phenolphtalein(xem h×nh bªn). Nªu c¸c hiÖn tîng x¶y ra. Gi¶i thÝch. Bé Gi¸o Dôc Vµ §µo T¹o ®Ò thi chÝnh thøc §Ò Thi Quèc Gia Chän HäC SINH Giái THPT M«n Thi: Ho¸ Häc - B¶ng A Ngµy thi: 13/3/2000 (180 phót, kh«ng kÓ thêi gian giao ®Ò ) C©u I: 1) Cho c¸c chÊt sau: HNO3, Cu, Fe, Na, S, C, NaNO3, Cu(NO3)2, NH4NO3. H·y viÕt tÊt c¶ c¸c ph¬ng tr×nh ph¶n øng cã thÓ t¹o ra khÝ NO2, ghi râ ®iÒu kiÖn ph¶n øng (nÕu cã). 2) Muèi amoni vµ muèi kim lo¹i kiÒm gièng vµ kh¸c nhau c¬ b¶n ë nh÷ng ®iÓm nµo? Nªu ra mét vµi thÝ dô cô thÓ. Tuyeån taäp ñeà thi hoïc sinh gioûi Quoác Gia Trang:15 ********************************************************************************************************************************* 3) Trong phßng thÝ nghiÖm ho¸ häc cã 8 lä ho¸ chÊt mÊt nh·n ®ùng riªng biÖt c¸c dd: NaCl; NaNO 3; MgCl2; Mg(NO3)2; AlCl3; Al(NO3)3; CrCl3;Cr(NO3)3. B»ng ph¬ng ph¸p ho¸ häc, lµm thÕ nµo nhËn biÕt ®îc mçi dd? ViÕt c¸c ph¬ng tr×nh ph¶n øng x¶y ra vµ ghi ®iÒu kiÖn (nÕu cã) 4) H·y hoµn thµnh c¸c ph¬ng tr×nh ph¶n øng h¹t nh©n sau ®©y (cã ®Þnh luËt b¶o toµn nµo ®îc dïng khi hoµn thµnh ph¬ng tr×nh trªn ?) a. 92U238  90Th230 + ... b. 92U235  82Pb206 + ... C©u II: 1) §Ó x¸c ®Þnh hµm lîng oxi tan trong níc ngêi ta lÊy 100,00ml níc råi cho ngay MnSO4 (d) vµ NaOH vµo níc. Sau khi l¾c kÜ (kh«ng cho tiÕp xóc víi kh«ng khÝ) Mn(OH) 2 bÞ oxi ho¸ thµnh MnO(OH)2. Thªm axit (d), khi lÊy MnO(OH)2 bÞ Mn2+ khö thµnh Mn3+. Cho Kl (d) vµo hçn hîp. Mn3+ oxi ho¸ I- thµnh I3-. ChuÈn ®é I3hÕt 10,50ml Na2S2O3 9,800.10-3M a. ViÕt c¸c ph¬ng tr×nh ion cña c¸c ph¶n øng ®· x¶y ra trong thÝ nghiÖm. b. TÝnh hµm lîng (mol/l) cña oxi tan trong níc. 2) Tõ c¸c nguyªn tè O, Na, S t¹o ra ®îc c¸c muèi A, B ®Òu cã 2 nguyªn tö Na trong ph©n tö. Trong mét thÝ nghiÖm ho¸ häc ngêi ta cho m1 gam muèi A biÕn ®æi thµnh m 2 gam muèi B vµ 6,16 lÝt khÝ Z t¹i 27,3 oC; 1atm. BiÕt r»ng hai khèi lîng ®ã kh¸c nhau 16,0 gam. a. H·y viÕt ph¬ng tr×nh ph¶n øng x¶y ra víi c«ng thøc cô thÓ cña A, B. b. TÝnh m1, m2. C©u III: 1) ViÕt c¸c ph¬ng tr×nh ph¶n øng x¶y ra (nÕu cã) cña khÝ clo, tinh thÓ iot t¸c dông víi: a. Dung dÞch NaOH (ë nhiÖt ®é thêng, khi ®un nãng) b. Dung dÞch NH3. 2) Trong c«ng nghÖ ho¸ dÇu, c¸c ankan ®îc lo¹i hi®ro ®Ó chuyÓn thµnh hi®rocacbon kh«ng no cã nhiÒu øng d¹ng h¬n. H·y tÝnh nhiÖt cña mçi ph¶n øng sau ®©y: C4H10  C4H6 + H2 ; Ho1 (1) CH4  C6H6 + H2 ; Ho2 (2) BiÕt n¨ng lîng liªn kÕt. E theo kJ.mol-1, cña c¸c liªn kÕt nh sau: E. theo kJ.mol-1 435,9 416,3 409,1 587,3 Liªn kÕt H-H C-H C-C C=C (Víi c¸c liªn kÕt C-H, C-C, c¸c trÞ sè ë trªn lµ trung b×nh trong c¸c hîp chÊt hi®rocacbon kh¸c nhau). C©u IV: 1. H·y viÕt ph¬ng tr×nh ho¸ häc vµ cÊu h×nh electron t¬ng øng cña chÊt ®Çu, s¶n phÈm trong mçi trêng hîp sau ®©y: a. Cu2+ (z=29) nhËn thªm 2e b. Fe2+ (z=26) nhêng bít 1e c. Bro (z=35) nhËn thªm 1e d. Hgo (z=80) nhêng bít 2e 2. Hoµ tan 7,180 gam s¾t côc chøa Fe2O3 vµo mét lîng rÊt d dd H2SO4 lo·ng råi thªm níc cÊt ®Õn thÓ tÝch ®óng 500ml. LÊy 25ml dd ®ã råi thªm dÇn 12,50 ml dd KMnO4 0,096M th× xuÊt hiÖn mµu hång tÝm trong dd. a. X¸c ®Þnh hµm lîng (phÇn tr¨m vÒ khèi lîng) cña Fe tinh khiÕt trong s¾t côc. b. NÕu lÊy cïng mét khèi lîng s¾t côc cã cïng hµm lîng cña Fe tinh khiÕt nhng chøa t¹p chÊt FeO vµ lµm l¹i thÝ nghiÖm gièng nh trªn th× l¬ng dd KMnO4 0,096M cÇn dïng lµ bao nhiªu? C©u V: 1. Cho: Eo ë 25oC cña c¸c cÆp Fe2+ / Fe vµ Ag+ / Ag t¬ng øng b»ng -0,440V vµ 0,800V. Dïng thªm ®iÖn cùc hi®ro tiªu chuÈn, viÕt s¬ ®å cña pin ®îc dïng ®Ó x¸c ®Þnh c¸c thÕ ®iÖn cùc ®· cho. H·y cho biÕt ph¶n øng x¶y ra khi pin ®îc lËp tõ hai cÆp ®ã ho¹t ®éng. 2. a. H·y s¾p xÕp c¸c nguyªn tè Natri, Kali, Liti lïi theo thø tù gi¶m trÞ sè n¨ng lîng ion ho¸ thø nhÊt (I1). Dùa vµo c¨n cø nµo vÒ cÊu t¹o nguyªn tö ®Ó ®a ra qui luËt s¾p xÕp ®ã? b. Dùa vµo cÊu h×nh electron, h·y gi¶i thÝch sù lín h¬n n¨ng lîng ion ho¸ thø nhÊt (I1) cña Mg so víi Al (Mg cã I1 = 7,644 eV; Al cã I1 = 5,984 eV). -----o Bé Gi¸o Dôc Vµ §µo T¹o ®Ò thi chÝnh thøc o----- §Ò Thi Quèc Gia Chän HäC SINH Giái THPT M«n Thi: Ho¸ Häc - B¶ng A Ngµy thi: 14/3/2000 (180 phót, kh«ng kÓ thêi gian giao ®Ò ) Tuyeån taäp ñeà thi hoïc sinh gioûi Quoác Gia Trang:16 ********************************************************************************************************************************* C©u I: Cho s¬ ®å sau: A n - Butan axeton C D G 1,4-®ibrom-2-buten B 550-6000C B1 D1 C1 1) CH2 A1 B2 Mg ete khan C2 glixerin trinitrat CH2 O 2) H3O + D2 isoamylaxetat A, A1, B, B1, B2 ... D2 lµ c¸c hîp chÊt h÷u c¬. 1) H·y ghi c¸c chÊt cÇn thiÕt vµ ®iÒu kiÖn ph¶n øng trªn c¸c mòi tªn. 2) ViÕt c«ng thøc cÊu t¹o cña tÊt c¶ c¸c hîp chÊt h÷u c¬ ë s¬ ®å trªn. 3) ViÕt c¸c ph¬ng tr×nh ph¶n øng t¹o thµnh glixerin trinitrat tõ n-butan theo s¬ ®å trªn. C©u II: 1) T¸m hîp chÊt h÷u c¬ A, B, C, D, E, G, H, I ®Òu chøa 35,56%C; 5,19%H; 59,26%Br trong ph©n tö vµ ®Òu cã tØ khèi h¬i so víi nit¬ lµ 4,822. §un nãng A hoÆc B víi dd NaOH ®Òu thu ®îc an®chit n-butiric, ®un nãng C hoÆc D víi dd NaOH ®Òu thu ®îc etylmetylxeton. A bÒn h¬n B, C bÒn h¬n D, E bÒn h¬n G, H vµ I ®Òu cã c¸c nguyªn tö C* trong ph©n tö. a. ViÕt c«ng thøc cÊu tróc cña A, B, C, D, E, G, H vµ I. b. ViÕt c¸c ph¬ng tr×nh ph¶n øng x¶y ra. 2) Hai xicloankan M vµ N ®Òu cã tØ khèi h¬i so víi metan b»ng 5,25. Khi monoclo ho¸ (cã chiÕu s¸ng) th× M cho 4 hîp chÊt, N chØ cho 1 hîp chÊt duy nhÊt. a.H·y x¸c ®Þnh c«ng thøc cÊu t¹o cña M vµ N. b. Gäi tªn c¸c s¶n phÈm t¹o thµnh theo danh ph¸p IUPAC. c. Cho biÕt cÊu d¹ng bÒn nhÊt cña hîp chÊt t¹o thµnh tõ N, gi¶i thÝch. C©u III: 1) Axit xitric hay lµ axit limonic COOH COOH HOOC - CH2 - C - CH2 cã - COOH c¸c gi¸ trÞ pKa lµ 4,76; 3,13 OH vµ 6,40. H·y gäi tªn axit nµy theo danh ph¸p IUPAC vµ ghi (cã gi¶i thÝch) tõng gi¸ trÞ pKa vµo nhãm chøc thÝch hîp. 2) §un nãng axit xitric tíi 176oC thu ®îc axit aconitic (C6H6O6). Khö axit aconitic sinh ra axit tricacbalylic (hay lµ axit propan-1,2,3-tricacboxylic). NÕu tiÕp tôc ®un nãng axit aconitic sÏ thu ®îc hçn hîp gåm axit itaconic (C5H6O4, kh«ng cã ®ång ph©n h×nh häc) vµ axit xitraconic (C 5H6O4 cã ®ång ph©n h×nh häc); hai axit nµy chuyÓn ho¸ ngay thµnh c¸c hîp chÊt m¹ch vßng cïng cã c«ng thøc ph©n tö C5H4O3. H·y viÕt s¬ ®å c¸c ph¶n øng x¶y ra díi d¹ng c¸c c«ng thøc cÊu t¹o vµ cho biÕt axit aconitic cã ®ång ph©n h×nh häc hay kh«ng? 3)Ngêi ta cã thÓ tæng hîp axit xitric xuÊt ph¸t tõ axeton vµ c¸c ho¸ chÊt v« c¬ cÇn thiÕt. H·y viÕt s¬ ®å c¸c ph¶n øng ®· x¶y ra. C©u IV: 1) X lµ mét ®isaccarit kh«ng khö ®îc AgNO3 trong dd amoniac. Khi thuû ph©n X sinh ra s¶n phÈm duy nhÊt lµ M (D-andoz¬, cã c«ng thøc vßng ë d¹ng ). M chØ kh¸c D-riboz¬ ë cÊu h×nh nguyªn tö C2. H 2O CH3OH CH3I M ��� N ��� Q ��� � dÉn xuÊt 2,3,4-tri-O-metyl cña M HCl xt� baz xt� xt H + a. X¸c ®Þnh c«ng thøc cña M, N, Q vµ X (d¹ng vßng ph¼ng). b. H·y viÕt s¬ ®å c¸c ph¶n øng ®· x¶y ra. 2) §èt ch¸y 0,2 mol hîp chÊt A thuéc lo¹i t¹p chøc thu ®îc 26,2 gam khÝ CO2; 12,6 gam h¬i H2O vµ 2,24 lÝt khÝ N2 (®ktc). NÕu ®èt ch¸y 1 mol A cÇn 3,75 mol O2. a. X¸c ®Þnh c«ng thøc ph©n tö cña A. b. X¸c ®Þnh c«ng thøc cÊu t¹o vµ tªn cña A. BiÕt r»ng A cã tÝnh chÊt lìng tÝnh, ph¶n øng víi axit nit¬ gi¶i phãng nit¬; víi ancol etylic cã axit lµm xóc t¸c t¹o thµnh hîp chÊt cã c«ng thøc C 5H11O2N. Khi ®un nãng A chuyÓn thµnh hîp chÊt vßng cã c«ng thøc C6H10N2O2. H·y viÕt ®Çy ®ñ c¸c ph¬ng tr×nh ph¶n øng x¶y ra vµ ghi ®iÒu kiÖn (nÕu cã). A cã ®ång ph©n lo¹i g×? C©u V: Tuyeån taäp ñeà thi hoïc sinh gioûi Quoác Gia Trang:17 ********************************************************************************************************************************* 1) Cã 5 lä ®ùng riªng biÖt c¸c chÊt: cumen hay lµ isopropylbenzen (A), ancol benzylic (B), anisol hay lµ metyl phenyl ete (C), benzan®ehit (D) vµ axit benzoic (E). BiÕt (A), (B), (C), (D) lµ c¸c chÊt láng. a. H·y s¾p xÕp thø tù t¨ng dÇn nhiÖt ®é s«i, gi¶i thÝch. b. Trong qu¸ tr×nh b¶o qu¶n c¸c chÊt trªn, cã 1 lä ®ùng chÊt láng thÊy xuÊt hiÖn tinh thÓ. H·y gi¶i thÝch hiÖn tîng ®ã b»ng ph¬ng tr×nh ph¶n øng ho¸ häc. c. H·y cho biÕt c¸c cÆp chÊt nµo nãi trªn cã thÓ ph¶n øng víi nhau. ViÕt c¸c ph¬ng tr×nh ph¶n øng vµ ghi ®iÒu kiÖn (nÕu cã). 2) Trong qu¸ tr×nh ®iÒu chÕ metyl tert-butyl ete (MTBE) tõ ancol, ngêi ta thu ®îc thªm 2 s¶n phÈm kh¸c. a. ViÕt ph¬ng tr×nh ph¶n øng ®iÒu chÕ MTBE tõ hi®rocacbon. b. ViÕt c«ng thøc cÊu t¹o 2 s¶n phÈm nãi trªn. c. ViÕt c«ng thøc cÊu t¹o c¸c s¶n phÈm sinh ra vµ ph¬ng tr×nh ph¶n øng khi cho MTBE t¸c dông víi HI. 3) Cã 1 hçn hîp c¸c chÊt r¾n gåm: p-tolui®in (p-metylanilin), axit benzoic, naphtalen. Tr×nh bµy ng¾n gän ph¬ng ph¸p ho¸ häc ®Ó t¸ch riªng tõng chÊt. Bé Gi¸o Dôc Vµ §µo T¹o ®Ò thi chÝnh thøc §Ò Thi Quèc Gia Chän HäC SINH Giái THPT M«n Thi: Ho¸ Häc - B¶ng A Ngµy thi: 14/3/2001 (180 phót, kh«ng kÓ thêi gian giao ®Ò ) C©u I (4 ®iÓm): 1. Ph¬ng ph¸p sunfat cã thÓ ®iÒu chÕ ®îc chÊt nµo: HF , HCl , HBr , HI ? NÕu cã chÊt kh«ng ®iÒu chÕ ®îc b»ng ph¬ng ph¸p nµy, h·y gi¶i thÝch t¹i sao? ViÕt c¸c ph¬ng tr×nh ph¶n øng vµ ghi râ ®iÒu kiÖn (nÕu cã) ®Ó minh ho¹. 2. Trong d·y oxiaxit cña clo, axit hipoclor¬ lµ quan träng nhÊt. axit hipoclor¬ cã c¸c tÝnh chÊt: a) TÝnh axit rÊt yÕu, yÕu h¬n axit cacbonic; b) Cã tÝnh oxi ho¸ m·nh liÖt; c) RÊt dÔ bÞ ph©n tÝch khi cã ¸nh s¸ng mÆt trêi, khi ®un nãng. H·y viÕt c¸c ph¬ng tr×nh ph¶n øng ®Ó minh ho¹ c¸c tÝnh chÊt ®ã. 3. Cã c¸c dung dÞch (bÞ mÊt nh·n) : a) BaCl2 ; b) NH4Cl ; c) K2S ; d) Al2(SO4)3 ; e) MgSO4 ; g) KCl ; h) ZnCl2 . §îc dïng thªm dung dÞch phenolphtalein (kho¶ng pH chuyÓn mµu tõ 8 - 10) hoÆc metyl da cam (kho¶ng pH chuyÓn mµu tõ 3,1 - 4,4). H·y nhËn biÕt mçi dung dÞch trªn, viÕt c¸c ph¬ng tr×nh ion (nÕu cã) ®Ó gi¶i thÝch. 4. T×m c¸ch lo¹i s¹ch t¹p chÊt khÝ cã trong khÝ kh¸c vµ viÕt c¸c ph¬ng tr×nh ph¶n øng x¶y ra: a) CO cã trong CO2 ; b) H2S cã trong HCl ; c) HCl cã trong H2S ; d) HCl cã trong SO2 ; e) SO3 cã trong SO2 . C©u II (3,5 ®iÓm): 1. H·y dïng kÝ hiÖu « lîng tö biÓu diÔn c¸c trêng hîp sè lîng electron trong mét obitan nguyªn tö. 2. Mçi ph©n tö XY3 cã tæng c¸c h¹t proton, n¬tron, electron b»ng 196; trong ®ã, sè h¹t mang ®iÖn nhiÒu h¬n sè h¹t kh«ng mang ®iÖn lµ 60, sè h¹t mang ®iÖn cña X Ýt h¬n sè h¹t mang ®iÖn cña Y lµ 76. a) H·y x¸c ®Þnh kÝ hiÖu ho¸ häc cña X,Y vµ XY3 . b) ViÕt cÊu h×nh electron cña nguyªn tö X,Y. c) Dùa vµo ph¶n øng oxi ho¸ - khö vµ ph¶n øng trao ®æi, h·y viÕt ph¬ng tr×nh ph¶n øng (ghi râ ®iÒu kiÖn, nÕu cã) c¸c trêng hîp x¶y ra t¹o thµnh XY3. C©u III (5 ®iÓm): 1. Hoµn thµnh ph¬ng tr×nh ph¶n øng a) , b) sau ®©y. Cho biÕt c¸c cÆp oxi ho¸ - khö liªn quan ®Õn ph¶n øng vµ so s¸nh c¸c gi¸ trÞ Eo cña chóng. a) Zn[Hg(SCN)4] + IO3- + ClICl + SO42- + HCN + Zn2+ + Hg2+ 2+ b) Cu(NH3)m + CN + OH Cu(CN)2- + CNO- + H2O 2. Dung dÞch X cã chÊt tan lµ muèi M(NO3)2 . Ngêi ta dïng 200ml dung dÞch K3PO4 võa ®ñ ph¶n øng víi 200ml dung dÞch X, thu ®îc kÕt tña M3(PO4)2 vµ dung dÞch Y. Khèi lîng kÕt tña ®ã (®· ®îc sÊy kh«) kh¸c khèi lîng M(NO3)2 ban ®Çu lµ 6,825 gam. §iÖn ph©n 400 ml dung dÞch X b»ng dßng ®iÖn I = 2 ampe tíi khi thÊy khèi lîng catèt kh«ng t¨ng thªm n÷a th× dõng, ®îc dung dÞch Z. Gi¶ thiÕt sù ®iÖn ph©n cã hiÖu suÊt 100%. a) H·y t×m nång ®é ion cña dung dÞch X, dung dÞch Y, dung dÞch Z. Cho biÕt c¸c gÇn ®óng ph¶i chÊp nhËn khi tÝnh nång ®é dung dÞch Y, dung dÞch Z. b) TÝnh thêi gian (theo gi©y) ®· ®iÖn ph©n. c) TÝnh thÓ tÝch khÝ thu ®îc ë 27,3oC , 1atm trong sù ®iÖn ph©n. C©u IV (4 ®iÓm): 1. Sunfuryl ®iclorua SO2Cl2 lµ ho¸ chÊt phæ biÕn trong ph¶n øng clo ho¸. T¹i 350oC, 2 atm ph¶n øng SO2Cl2 (khÝ) �� + Cl2 (khÝ) (1) ��� � SO2 (khÝ) Cã Kp = 50 . a) H·y cho biÕt ®¬n vÞ cña trÞ sè ®ã vµ gi¶i thÝch: h»ng sè c©n b»ng Kp nµy ph¶i cã ®¬n vÞ nh vËy. b) TÝnh phÇn tr¨m theo thÓ tÝch SO2Cl2(khÝ) cßn l¹i khi (1) ®¹t tíi c©n b»ng ë ®iÒu kiÖn ®· cho. Tuyeån taäp ñeà thi hoïc sinh gioûi Quoác Gia Trang:18 ********************************************************************************************************************************* c) Ban ®Çu dïng 150 mol SO2Cl2(khÝ), tÝnh sè mol Cl2(khÝ) thu ®îc khi (1) ®¹t tíi c©n b»ng. C¸c khÝ ®îc coi lµ khÝ lý tëng. 2. a) TÝnh ®é ®iÖn li cña dung dÞch CH3NH2 0,010M. b) §é ®iÖn li thay ®æi ra sao khi - Pha lo·ng dung dÞch ra 50 lÇn. - Khi cã mÆt NaOH 0,0010M. - Khi cã mÆt CH3COOH 0,0010M. - Khi cã mÆt HCOONa 1,00M. + BiÕt: CH3NH2 + H+ �� ; K = 1010,64 ��� � CH3NH3 + ��� CH3COOH ; K = 10-4,76 �� � CH3COO + H C©u V(3,5 ®iÓm): Ph¶n øng S2O82- + 2 I (1) �� � 2 SO42- + I2 ®îc kh¶o s¸t b»ng thùc nghiÖm nh sau: Trén dung dÞch KI víi dung dÞch hå tinh bét, dung dÞch S2O32- ; sau ®ã thªm dung dÞch S2O82- vµo dung dÞch trªn. C¸c dung dÞch ®Òu cã nång ®é ban ®Çu thÝch hîp. 1. ViÕt c¸c ph¬ng tr×nh ph¶n øng x¶y ra; t¹i sao dung dÞch tõ kh«ng mµu chuyÓn sang mµu xanh lam? 2. Ngêi ta thu ®îc sè liÖu sau ®©y: Thêi gian thÝ nghiÖm(theo gi©y) Nång ®é I- (theo mol . l -1) 0 1,000 20 0,752 50 0,400 80 0,010 Dïng sè liÖu ®ã, h·y tÝnh tèc ®é trung b×nh cña ph¶n øng (1). Bé Gi¸o Dôc Vµ §µo T¹o ®Ò thi chÝnh thøc §Ò Thi Quèc Gia Chän HäC SINH Giái THPT M«n Thi: Ho¸ Häc - B¶ng A Ngµy thi: 15/3/2001 (180 phót, kh«ng kÓ thêi gian giao ®Ò ) C©u I (5 ®iÓm): 1. XuÊt ph¸t tõ brombenzen chøa 14 C ë vÞ trÝ 1 vµ c¸c ho¸ chÊt v« c¬ cÇn thiÕt kh«ng chøa 14 C, h·y ®iÒu chÕ c¸c hîp chÊt th¬m chøa 14 C ë vÞ trÝ 3 : a) Anilin ; b) Iotbenzen ; c) Axit benzoic. 2. Hoµn thµnh s¬ ®å c¸c ph¶n øng sau vµ gäi tªn c¸c s¶n phÈm tõ A ®Õn F : Na2Cr2O4 2H C D Cl2 (1 mol) H2 O Benzen (1mol) A B FeCl3 t0C, p HNO3 Fe, HCl E F 3. Khi oxi ho¸ etylenglicol b»ng HNO3 th× t¹o thµnh mét hçn hîp 5 chÊt. H·y viÕt c«ng thøc cÊu t¹o ph©n tö cña 5 chÊt ®ã vµ s¾p xÕp theo trËt tù gi¶m dÇn nhiÖt ®é s«i cña chóng (cã gi¶i thÝch). C©u II (4 ®iÓm): N Xinconi®in (X) cã c«ng thøc cÊu t¹o : §ã lµ ®ång ph©n lËp thÓ ë C9 cña xinconin (Y). 1. H·y ghi dÊu * vµo mçi nguyªn tö cacbon bÊt ®èi vµ khoanh vßng trßn nguyªn tö nit¬ cã tÝnh baz¬ m¹nh nhÊt trong ph©n töCH X.= CH2 9 - ra c¸c s¶n phÈm chÝnh lµ A HOH 2. Cho tõ tõ dung dÞch HBr vµo X ë nhiÖt ®é phßng råi ®un nãngCnhÑ, sinh (C19H23BrON2) , B (C19H24Br2ON2) , C (C19H25Br3ON2) , vµ D (C19H24Br4N2). ChÕ ho¸ D víi dung dÞch KOH trong rîu 90o thu ®îc E (C19H20N2) H·y viÕt c«ng thøc cÊu t¹o cña A , B , C , D , E. Ghi dÊu * vµo mçi nguyªn tö cacbon bÊt ®èi trong ph©n tö D vµ E. 3. Cho C6H5COCl vµo X vµ Y thu ®îc s¶n phÈm ®Òu cã c«ng thøc C 26H26N2O2 (®Æt lµ F vµ G). F vµ G cã ®ång nhÊt (cïng lµ mét chÊt) hay kh«ng? Chóng cã nhiÖt ®é nãng ch¶y gièng hay kh¸c nhau? t¹i sao? C©u III (4 ®iÓm): 1.Cã mét hçn hîp protit gåm pepsin (pHI = 1,1), hemoglobin (pHI = 6,8) vµ prolamin (pHI = 12,0). Khi tiÕn hµnh ®iÖn di dung dÞch protit nªu trªn ë pH = 7,0 th× thu ®îc 3 vÕt chÊt (xem h×nh): XuÊt ph¸t Cùc • • • Cùc A B C Tuyeån taäp ñeà thi hoïc sinh gioûi Quoác Gia Trang:19 ********************************************************************************************************************************* Cho biÕt mçi vÕt chÊt ®Æc trng cho protit nµo ? Gi¶i thÝch. 2. Khi thuû ph©n hoµn toµn 1 mol tripeptit X thu ®îc 2 mol axit glutamic ( HOOC(CH2)2CH(NH2)COOH ), 1 mol alanin ( CH3CH(NH2)COOH ) vµ 1 mol NH3. X kh«ng ph¶n øng víi 2,4-®initroflobenzen vµ X chØ cã mét nhãm cacboxyl tù do. Thuû ph©n X nhê enzim cacboxipepti®aza thu ®îc alanin vµ mét ®ipeptit Y. ViÕt c«ng thøc cÊu t¹o cña X , Y vµ gäi tªn chóng. C©u IV (4,5 ®iÓm): Melexitoz¬ (C18H32O16) lµ ®êng kh«ng khö, cã trong mËt ong. Khi thuû ph©n hoµn toµn 1 mol melexitoz¬ b»ng axit sÏ nhËn ®îc 2 mol D-glucoz¬ vµ 1 mol D- fructoz¬. Khi thuû ph©n kh«ng hoµn toµn sÏ nhËn ®îc D-glucoz¬ vµ ®isaccarit turanoz¬. Khi thuû ph©n nhê enzim mantaza sÏ t¹o thµnh D-glucoz¬ vµ Dfructoz¬, cßn khi thuû ph©n nhê enzim kh¸c sÏ nhËn ®îc saccaroz¬. Metyl ho¸ 1 mol melexitoz¬ råi thuû ph©n sÏ nhËn ®îc 1 mol 1,4,6-tri-O-metyl-D-fructoz¬ vµ 2 mol 2,3,4,6-tetra-O-metyl-D-glucoz¬. 1. H·y viÕt c«ng thøc cÊu tróc cña melexitoz¬. ViÕt c«ng thøc cÊu tróc vµ gäi tªn hÖ thèng cña turanoz¬. 2. H·y chØ ra r»ng, viÖc kh«ng h×nh thµnh foman®ehit trong s¶n phÈm oxi ho¸ b»ng HIO 4 chøng tá cã cÊu tróc furanoz¬ hoÆc piranoz¬ ®èi víi m¾t xÝch fructoz¬ vµ piranoz¬ hoÆc heptanoz¬ (vßng 7 c¹nh) ®èi víi m¾t xÝch glucoz¬. 3. CÇn bao nhiªu mol HIO4 ®Ó ph©n huû hai m¾t xÝch glucoz¬ cã cÊu tróc heptanoz¬ vµ sÏ nhËn ®îc bao nhiªu mol axit fomic? C©u V (2,5 ®iÓm): 1. Clorofom tiÕp xóc víi kh«ng khÝ ngoµi ¸nh s¸ng sÏ bÞ oxi hãa thµnh photgen rÊt ®éc. §Ó ngõa ®éc ngêi ta b¶o qu¶n clorofom b»ng c¸ch cho thªm mét lîng nhá ancol etylic ®Ó chuyÓn photgen thµnh chÊt kh«ng ®éc. ViÕt ph¬ng tr×nh ph¶n øng oxi hãa clorofom b»ng oxi kh«ng khÝ thµnh photgen, ph¶n øng cña photgen víi ancol etylic vµ gäi tªn s¶n phÈm. 2. §un nãng vµi giät clorofom víi lîng d dung dÞch NaOH, sau ®ã nhá thªm vµi giät dung dÞch KMnO4 thÊy hçn hîp xuÊt hiÖn mµu xanh. ViÕt c¸c ph¬ng tr×nh ph¶n øng vµ gi¶i thÝch sù xuÊt hiÖn mµu xanh. 3. Khi tiÕn hµnh ®iÒu chÕ axit lactic tõ an®ehit axetic vµ axit xianhi®ric, ngoµi s¶n phÈm mong muèn ta cßn thu ®îc hîp chÊt X (C6H8O4). ViÕt c«ng thøc cÊu t¹o cña X vµ c¸c ph¬ng tr×nh ph¶n øng x¶y ra. 1. ViÕt ph¬ng tr×nh ph¶n øng ®iÒu chÕ D-fructoz¬ tõ D-glucoz¬, biÕt r»ng D-glucozazon khi t¸c dông víi benzandehit t¹o thµnh ozon cña D-glucoz¬ (HOCH2(CHOH)3COCHO). 2. Chitin (t¸ch tõ vá t«m, cua...) ®îc coi nh lµ dÉn xuÊt cña xenluloz¬, trong ®ã c¸c nhãm hidroxyl ë c¸c nguyªn tö C2 ®îc thay thÕ b»ng c¸c nhãm axetylamino ( -NH-CO-CH3 ). a) ViÕt c«ng thøc cÊu t¹o mét ®o¹n m¹ch cña ph©n tö chitin. b) Gäi tªn mét m¾t xÝch cña chitin. c) ViÕt ph¬ng tr×nh ph¶n øng x¶y ra khi ®un nãng chitin víi dung dÞch HCl ®Æc (d), ®un nãng chitin víi dung dÞch NaOH ®Æc (d). C©u III (5 ®iÓm): (thay c©u III b¶ng A, dïng cho b¶ng B) 1. Cho hçn hîp ®¼ng ph©n tö gåm axit benzoic vµ axit p-metoxibenzoic t¸c dông víi hçn hîp HNO3 ®Æc vµ H2SO4 ®Æc. ViÕt c«ng thøc cÊu t¹o hai s¶n phÈm mononitro chÝnh vµ cho biÕt chÊt nµo t¹o thµnh víi sè mol nhiÒu h¬n? H·y so s¸nh tÝnh axit cña c¸c chÊt gåm hai axit ®Çu vµ hai s¶n phÈm, gi¶i thÝch. 2. Cã c¸c hîp chÊt sau: H3NCH2COO (A) , H2NCH2CONH2 (B) , H2N-CO-NH2 (C) , CH3CHOHCOOH (D). Cho biÕt tõng hîp chÊt trªn thuéc lo¹i hîp chÊt cã chøc h÷u c¬ nµo? ViÕt ph¬ng tr×nh ph¶n øng cña tõng hîp chÊt trªn víi: a) Dung dÞch HCl (d, nãng) ; b) Dung dÞch NaOH (d, nãng). bé gi¸o dôc vµ ®µo t¹o ®Ò thi chÝnh thøc k× thi chän häc sinh giái quèc gia líp 12 thpt n¨m häc 2000-2001 M«n : ho¸ häc B¶ng B Thêi gian : 180 phót ( kh«ng kÓ thêi gian giao ®Ò ) Ngµy thi : 13 / 3 / 2001 C©u I (5 ®iÓm): 1. XuÊt ph¸t tõ brombenzen chøa 14 C ë vÞ trÝ 1 vµ c¸c ho¸ chÊt v« c¬ cÇn thiÕt kh«ng chøa c¸c hîp chÊt th¬m chøa 14 C ë vÞ trÝ 3 : a) Anilin ; b) Iotbenzen ; c) Axit benzoic. 2. Hoµn thµnh s¬ ®å c¸c ph¶n øng sau vµ gäi tªn c¸c s¶n phÈm tõ A ®Õn F : 14 C, h·y ®iÒu chÕ
- Xem thêm -