[hoahoc11]dethidenghi-olympic30thang4-lanthuxii-2006-thptchuyennguyendu-daklak

  • Số trang: 6 |
  • Loại file: DOC |
  • Lượt xem: 24 |
  • Lượt tải: 0
uchihasasuke

Đã đăng 588 tài liệu

Mô tả:

Kỳ thi Olympic 30/04/2006 Trường THPT Chuyên Nguyễn Du, tỉnh Đăk Lăk Đề và đáp án: Môn Hóa - Khối 11 Số mật mã: 1 ĐỀ: Câu: 1 ( 4điểm) 1.1. Xác định năng lượng ion hoá thứ nhất của nguyên tử silic (Z = 14) ở trạng thái cơ bản Cho: E(n,l) = - 13,6 [Z*(n,l)/n*] 2 ; với Z*:điện tích hiệu dụng ; n*: số lượng tử biểu kiến. 1.2. Cho dòng điện 5A đi qua dung dịch muối của axit hữu cơ trong thời gian 19 phút 18 giây. Kết quả sau quá trình điện phân là trên catot tạo ra 6,21 g một kim loại và trên anot có khí etan và khí cacbonic thoát ra. 1.2.1. Xác định công thức của muối đã bị điện phân? 1.2.2. Viết phương trình phản ứng xảy ra trên các điện cực? 1.2.3. Tính thể tích khí etan thoát ra ở (đktc)? Câu: 2 (4điểm) Kim loại A phản ứng với phi kim B tạo hợp chất C. Cho 0,1 mol hợp chất C phản ứng với CO2 dư tạo thành hợp chất D và 2,4g B. Hoà tan hoàn toàn D vào nước, dung dịch D phản ứng vừa đủ 100ml dung dịch HCl 1M giải phóng 1,12 lít khí CO2 (đktc). Hãy xác định A, B, C, D và viết phương trình phản ứng xảy ra. Biết hợp chất C chứa 45,07% B theo khối lượng ; hợp chất D không bị phân tích khi nóng chảy. Câu: 3 (4điểm) Ở 8200C cho Kp các cân bằng sau: (1) CaCO3 CaO + CO2 Kp = 0,2 (2) MgCO3 MgO + CO2 Kp = 0,4 Người ta đưa 1mol CaO; 1mol MgO và 3mol CO 2 vào một xilanh có thể tích rất lớn, ban đầu là chân không và giữ ở 8200C. Nhờ một pittong nén từ từ thể tích trong xilanh. Xác định thể tích của CO2 khi bắt đầu và chấm dứt mỗi cân bằng? Câu: 4 ( 4điểm) Dung dịch A là dung dịch CaCl 2 trong nước có nồng độ 1,780g/l. Dung dịch B là dung dịch Na2CO3 trong nước có nồng độ 1,700g/l. (Cho: pKa1(H2CO3) = 6,37 ; pKa2(H2CO3) = 10,33 ) Fe 4.1. Hãy tính giá trị pH của dung dịch B. 4.2. TrộnCl100ml dung dịch dung tạo ra dung dịch C. Dung dịch C được ) MgA với 100ml 1) etilen oxit dịchHB 2 (1 mol 2SO 4 chỉnh đến pH = 10 . Hãy tính toán để kết luận có kết 15 tủa0Cnào tạo thành? (Cho T Ca(OH)2 = 6,46.10-6 mol3.l-3 ; T CaCO3 = 3,31.10-9mol2.l-2 ) Câu:5 ( 4điểm) 5.1. 3-Metylbuten-1 tác dụng với axit bromhidric tạo ra 6 sản phẩm trong đó có A là 2-brom3-metylbutan và B là 2-brom-2-metylbutan. Bằng cơ chế phản ứng hãy giải thích sự tạo thành 2 sản phẩm A, B? 5.2. Viết các phương trình phản ứng theo sơ đồ chuyển hoá sau ( các chất từ A, B, …G 2 ) là các hợp chất hữu cơ viết dưới dạng cấu tạo. E1 + E2 + C6H5CH3  A  B  C  D  as Ete khan 2) H3O (1 mol) as (1 mol) 2 Kỳ thi Olympic 30/04/2006 Trường THPT Chuyên Nguyễn Du, tỉnh Đăk Lăk Đề và đáp án: Môn Hóa - Khối 11 Số mật mã: G1 + G2 5.3. Một hợp chất hữu cơ A chỉ chứa một nguyên tử oxi trong phân tử. Phân tử A có chứa 79,59%C ; 12,25%H ; còn lại là oxi. Ozon phân A thu được HOCH 2CH=O ; CH3CH2CH2COCH3 và CH3CH2COCH2CH2CH=O. Nếu cho A tác dụng với brom theo tỉ lệ mol 1:1 rồi mới ozon phân sản phẩm chính sinh ra, thì thu được hai sản phẩm hữu cơ trong đó có một xeton. Đun nóng A với dung dịch axit dễ dàng thu được sản phẩm B có cùng phân tử như A, song khi ozon phân B chỉ cho một sản phẩm hữu cơ duy nhất. 5.3.1. Xác định công thức cấu tạo và gọi tên A? 5.3.2. Tìm công thức cấu tạo của B và viết cơ chế của phản ứng chuyển hoá A thành B? ĐÁP ÁN: Câu1: (4điểm) 1.1(1điểm) Ở trạng thái cơ bản cấu hình e của: Si(Z = 14) là: 1s22s22p63s23p2 Của ion Si+ là: 1s22s22p63s23p1 Với 3s = 3p = (2.1)+(8.0,85)+(3.0,35) = 9,85 Điện tích hiệu dụng tác dụng lên các electron này là: Z*3s = Z*3p = 14-9,85 = 4,15  E3s = E3p = -13,6(4,15/3)2 = -26,02 eV. Trong ion Si+: Với 3s = 3p = (2.1)+(8.0,85)+(2.0,35) = 9,5 Z*3s = Z*3p = 14 -9,5 = 4,5  E3s = E3p = -13,6(4,5/3)2 = -30,6 eV  EI = E(Si+)- E(Si) = 3.(-30,6)-4.(-26,02) = 12,3 eV (1điểm) 1.2.(3 điểm) 1.2.1(1điểm) Số mol e trao đổi = It:F = 5.(19.60+18):96500 = 0,06mol. Ở catot xảy ra quá trình sau: Mn+ + ne  M0 (0,5điểm) 0,06mol 0,06/n mol M = 6,21.n:0,06 = 103,5.n n = 1  M = 103,5 (loại) n = 2  M = 207 (Pb) n = 3  M = 310,5 (loại) (0,5diểm) Vậy công thức phân tử của muối bị điện phân là (CH3COO)2Pb. 1.2.2.(1,5 điểm) Phương trình phản ứng xảy ra trên các điện cực: Catot: Pb2+, H+(H2O) Pb2+ + 2e  Pb 0,06mol 0,03mol Anot: CH3COO-, OH-(H2O) 2CH3COO- - 2e  2CH3COO  2CH3COO  2CH3 + 2CH3  CH3CH3 2 CH3COO - 2e  CH3CH3 + Br- (0,5điểm) 2CO2 (1điểm) 2CO2 3 Kỳ thi Olympic 30/04/2006 Trường THPT Chuyên Nguyễn Du, tỉnh Đăk Lăk Đề và đáp án: Môn Hóa - Khối 11 Số mật mã: ptđp: (CH3COO)2Pb  Pb + CH3CH3 + 2CO2 1.2.3. (0,5điểm) Theo ptđp ta có: Số mol Pb = Số mol CH3CH3 = ½ Số mol e = 0,06:2 = 0,03 mol Vậy thể tích etan thu được là : 0,03.22,4 = 0,672 lít . (0,5điểm) Câu 2: (4điểm) Số mol HCl = 0,1.1 = 0,1mol Số mol CO2 = 1,12:22,4 = 0,05mol Số mol H+ : Số mol CO2 = 2:1  Hợp chất D là muối CO32Mặt khác D không bị phân tích khi nóng chảy  D cacbonat kim loại kiềm 2H+ + CO32- = H2O + CO2 C + CO2 = D + B  C peoxit hoặc supeoxit B là oxi Đặt công thức hoá học của C là MxOy Lượng oxi có trong 0,1mol C(MxOy) là : 16.0,05+2,4 = 3,2 g Khối lượng của 0,1mol C là = 3,2.100:45,07 = 7,1g  Mc = 7,1:0,1 = 71 g/mol  Khối lượng của kim loại M trong MxOy = 7,1- 3,2 = 3,9 g Ta có: x : y = 3,9/ M : 3,2/ 16  M = 39 Vậy: A là Kali ( K ) B là Oxi ( O2 ) C là KO2 D là K2CO3 Các phương trình: K + O2  KO2 4KO2 + 2CO2  2K2CO3 + 3O2 K2CO3 + 2HCl  2KCl + CO2 + H2O Câu 3: (4điểm) Khi P(CO2 ) < 0,2 atm  không có phản ứng xảy ra. Khi P(CO2 ) = 0,2 atm V1 = n.RT/P = 3.22,4.(273+820):273.0,2 = 1345,23 lít (1điểm) (1điểm) (1điểm) (0,5điểm) (0,5điểm) (0,5điểm) Khi P(CO2 ) = 0,2 atm, cân bằng sau xảy ra: CaO + CO2 CaCO3 (1) Khi V giảm, P(CO2 ) không thay đổi, do CO2 tham gia vào cân bằng (1), đến khi CaO hết 1 mol thì CO2 tiêu thụ hết 1mol  CO2 còn 2 mol V2 = 2.22,4.(273+820):273.0,2 = 896,82 lít (1điểm) Khi 0,2 atm < P (CO2 ) < 0,4 atm không có phản ứng hoá học xảy ra. Kỳ thi Olympic 30/04/2006 Trường THPT Chuyên Nguyễn Du, tỉnh Đăk Lăk Đề và đáp án: Môn Hóa - Khối 11 Số mật mã: Khi P ( CO2 ) = 0,4 atm V3 = 2.22,4.(273+820):273.0,4 = 448,41 lít 4 (0,5điểm) Khi P ( CO2 ) = 0,4 atm cân bằng sau xảy ra: MgO + CO2 MgCO3 (2) Khi V giảm , P (CO2 ) không thay đổi do CO2 tham gia vào cân bằng (2) đến khi MgO tiêu thụ hết 1mol, CO2 tiêu thụ hết 1mol  CO2 còn lại 1mol . V4 = 1.22,4.(273+820):273.0,4 = 224,20 lít (1điểm) Vậy : 896,82 lít < V < 1345,23 lít  cân bằng (1) xảy ra. 448,41 lít < V < 896,82 lít  không có phản ứng xảy ra. 224,20 lít < V < 448,41 lít  cân bằng (2) xảy ra. (1điểm) Câu 4 (4điểm) 4.1. (2điểm) HCO3- OH- Kb2 = Kb2 = 10-14:10-10,35 = 2,14.10-4 CO32- Kb1 =2,34.10-8 >> Kb1 do đó ta chỉ xét sự proton hoá một nấc của CO32- Vì: Kb2   CO32- + H2O C0 – x mol/l HCO3- + x mol/l OH- Kb2 x mol/l C0(Na2CO3) = 1,700 g.l-1 : 106 g.mol-1 = 0,016 mol.l-1  x2 : (0,016 – x) = 2,14.10-4  x = 1,75.10-3  pH = 11,3 4.2. (2điểm) Sau khi trộn dung dịch A với dung dịch B ta có: C0 (Na2CO3) = 1,700 g.l-1 : 2.106 g.mol-1 = 0,008 mol.l-1 C0 (CaCl2) = 1,780 g.l-1 : 2.111 g.mol-1 = 0,008 mol.l-1 Ta có : OH-2 Ca2+ = (10-4)2.8.10-3 = 8.10-11 mol3l-3 < 6,46.10-6 mol3l-3 Vậy không có kết tủa Ca(OH)2 xuất hiện Ta có : HCO3- OH- (1điểm) (1điểm) HCO3- = Kb2 . CO32- : OH- CO32- = 2,14 . CO32- HCO3- + . CO32- = C0 (Na2CO3) = 0,008 mol.l-1  CO32- = 2,55.10-3 mol.l-1  Ca2+ = 8.10-3 mol.l-1  Ca2+ . CO32- = 8.10-3. 2,55.10-3 = 2,04.10-5 mol2l-2 > 3,31.10-9 mol2l-2 Vậy có kết tủa CaO3 xuất hiện. (1điểm) Kb2 =  (1điểm) 5 Kỳ thi Olympic 30/04/2006 Trường THPT Chuyên Nguyễn Du, tỉnh Đăk Lăk Đề và đáp án: Môn Hóa - Khối 11 Số mật mã: Câu 5:(4 điểm) 5.1 (1điểm) + (CH3)2CHCH=CH2 H (CH3)2CHCH2+CH2 (I) Ch.vi (CH3)2CH CHCH3 (II)  + (CH3)2 CH CHCH3 (III) Br (II)  (CH3)2CHCHBrCH3 (A) Br(III)  (CH3)2CBrCH2CH3 (B) (0,5điểm) + 5.2. (1 điểm) C6H5CH3 + + HCl Ete khan  C6H5CH2MgCl 1) oxit etilen C6H5CH2MgCl  2) H3O+ C6H5CH2CH2CH2OH H2SO4, 150C C6H5CH2CH2CH2OH  + H2O C6H5CH2Cl Cl2 as  + C6H5CH2Cl (0,5điểm) Mg Fe + Br2  + HBr Br + Br2 Fe  + HBr + HBr Br + Br2 as  as + Br2 Br  5.3(2điểm) 5.3.1(1,5điểm) Ta có: C : H : O = 79,59/12 : 12,25/1 : 8,16/16 = 13: 24: 1 Br + HBr (1điểm) 6 Kỳ thi Olympic 30/04/2006 Trường THPT Chuyên Nguyễn Du, tỉnh Đăk Lăk Đề và đáp án: Môn Hóa - Khối 11 Số mật mã: Vậy công thức phân tử của A là C13H24O (0,5điểm) Từ sản phẩm ozon phân ta tìm ra 2 công thức cấu tạo có thể có : CH3CH2CH2C(CH3)=CHCH2CH2C(CH2CH3)=CHCH2OH (A1) CH3CH2CH2C(CH3)=C(CH2CH3)CH2CH2CH=CHCH2OH (A2) (0,5điểm) Từ phản ứng brom hoá rồi ozon phân suy ra (A1) phù hợp Vì: Br2 Ozon phân (A1)  CH3CH2CH2C(CH3)BrCHBrCH2CH2C(CH2CH3)=CHCH2OH  1:1 Xeton + HOCH2CH=O Br2 Ozon phân (A2) CH CH CH C(CH )BrC(CH CH )BrCH CH CH=CHCH OH  3 2 2 3 2 3 2 2 2 1:1 Andehit + HOCH2CH=O Tên của A: 3-etyl-7-metyldeca-2,6-dien-1-ol (0,5 điểm) 5.3.2(0,5điểm) B phải là hợp chất mạch vòng có chứa 1 nối đôi , B sinh ra từ A do phản ứng đóng vòng. CH2OH H+, t0C -  H2O + CH2  + (A) H2O  - H+ (0,5điểm) OH (B) ----------------------o0o---------------------Người biên soạn: Nguyễn Trí
- Xem thêm -